![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
.jpg){kind=link}
.jpg){kind=link}
![[CULTIVATE]-Logo_200..>](%5bCULTIVATE%5d-Logo_200x200-02.jpg){kind=link}
_0.jpg){kind=link}
.jpg){kind=link}
.png){kind=link}
.jpg){kind=link}
%20-%20NL_0.jpg){kind=link}
%20-%20NL.jpg){kind=link}
.png){kind=link}
.png){kind=link}
.png){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.png){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20-%20500x500.png){kind=link}
.jpg){kind=link}
%20-%20500x500.png){kind=link}
2813.jpg){kind=link}
.jpg){kind=link}
_500x500.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
_0.png){kind=link}
.png){kind=link}
.png){kind=link}
.png){kind=link}
.png){kind=link}
.png){kind=link}
.jpg){kind=link}
.png){kind=link}
.png){kind=link}
.png){kind=link}
.png){kind=link}
.png){kind=link}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 079.jpg | 2024-07-09 16:39 | 27M | |
| 033.jpg | 2024-07-09 16:39 | 20M | |
| 041.jpg | 2024-07-09 16:39 | 19M | |
| 029.jpg | 2024-07-09 16:39 | 18M | |
| EngineOfInnovation_h..> | 2024-07-09 16:39 | 16M | |
| cedlsc01_024.JPG | 2024-07-09 16:39 | 14M | |
| 120.jpg | 2024-07-09 16:39 | 9.9M | |
| 61.jpg | 2024-07-09 16:39 | 9.7M | |
| 80.jpg | 2024-07-09 16:39 | 9.6M | |
| 002.jpg | 2024-07-09 16:39 | 9.4M | |
| 04.jpg | 2024-07-09 16:39 | 9.4M | |
| 008.jpg | 2024-07-09 16:39 | 9.3M | |
| 110.jpg | 2024-07-09 16:39 | 9.2M | |
| mati-pics-tatiana-he..> | 2024-07-09 16:40 | 8.8M | |
| Tim Griffin.jpg | 2024-07-09 16:40 | 8.8M | |
| 47.jpg | 2024-07-09 16:39 | 8.7M | |
| 84.jpg | 2024-07-09 16:39 | 8.5M | |
| 34.jpg | 2024-07-09 16:39 | 8.5M | |
| SmartSpectrum_Logo_1..> | 2024-07-09 16:40 | 8.4M | |
| 10.jpg | 2024-07-09 16:39 | 7.9M | |
| 62.jpg | 2024-07-09 16:39 | 7.7M | |
| 97.jpg | 2024-07-09 16:39 | 7.1M | |
| desk-discussing-disc..> | 2024-07-09 16:39 | 7.1M | |
| devon_headshot.png | 2024-07-09 16:39 | 6.7M | |
| CED 2017 0080.jpg | 2024-07-09 16:39 | 6.5M | |
| seguno.jpg | 2024-07-09 16:40 | 5.3M | |
| asphalt-bitumen-empt..> | 2024-07-09 16:39 | 5.3M | |
| CED 2017 0060.jpg | 2024-07-09 16:39 | 5.0M | |
| DSCF0798.JPG | 2024-07-09 16:39 | 4.6M | |
| 0194_CED-TVC-2014_ST..> | 2024-07-09 16:39 | 4.6M | |
| EngineOfInnovation_h..> | 2024-07-09 16:39 | 4.4M | |
| EngineOfInnovation_h..> | 2024-07-09 16:39 | 4.4M | |
| Vector_0.jpg | 2024-07-09 16:40 | 4.4M | |
| Vector.jpg | 2024-07-09 16:40 | 4.4M | |
| ORIED_logo_red_h-01_..> | 2024-07-09 16:40 | 4.1M | |
| SmartSpectrum_Logo_f..> | 2024-07-09 16:40 | 3.8M | |
| Nicholas DeMarco.jpg | 2024-07-09 16:40 | 3.6M | |
| Ursula - InHerSight.jpg | 2024-07-09 16:40 | 3.3M | |
| JB--headshot.jpg | 2024-07-09 16:40 | 3.2M | |
| DSCF0845.JPG | 2024-07-09 16:39 | 3.0M | |
| robbie-headshot.JPG | 2024-07-09 16:40 | 2.8M | |
| Debbie Brown.jpg | 2024-07-09 16:39 | 2.8M | |
| blur-book-stack-book..> | 2024-07-09 16:39 | 2.8M | |
| DSCF0668.JPG | 2024-07-09 16:39 | 2.6M | |
| JB--headshot_0.jpg | 2024-07-09 16:40 | 2.6M | |
| MW.jpg | 2024-07-09 16:40 | 2.5M | |
| Kanari_Yellow_0.jpg | 2024-07-09 16:40 | 2.5M | |
| Kanari_Yellow.jpg | 2024-07-09 16:40 | 2.5M | |
| Josh Roberto_0.JPG | 2024-07-09 16:40 | 2.5M | |
| Josh Roberto_1.JPG | 2024-07-09 16:40 | 2.5M | |
| JR--headshot.jpg | 2024-07-09 16:40 | 2.4M | |
| IMG_2495.jpg | 2024-07-09 16:39 | 2.4M | |
| CH--headshot.jpg | 2024-07-09 16:39 | 2.4M | |
| Josh Roberto.JPG | 2024-07-09 16:40 | 2.3M | |
| VS--headshot.jpg | 2024-07-09 16:40 | 2.3M | |
| 20190516-CED 35th An..> | 2024-07-09 16:39 | 2.3M | |
| 20190516-CED 35th An..> | 2024-07-09 16:39 | 2.3M | |
| action-adult-advice-..> | 2024-07-09 16:39 | 2.2M | |
| 20190516-CED 35th An..> | 2024-07-09 16:39 | 2.1M | |
| MW_0.jpg | 2024-07-09 16:40 | 2.1M | |
| 20190516-CED 35th An..> | 2024-07-09 16:39 | 2.1M | |
| 20190516-CED 35th An..> | 2024-07-09 16:39 | 2.0M | |
| IMG_0293.JPG | 2024-07-09 16:39 | 2.0M | |
| 20190516-CED 35th An..> | 2024-07-09 16:39 | 2.0M | |
| RC--headshot.jpg | 2024-07-09 16:40 | 2.0M | |
| IMG-6788.jpg | 2024-07-09 16:39 | 1.9M | |
| 20190516-CED 35th An..> | 2024-07-09 16:39 | 1.9M | |
| IMG-6784.JPG | 2024-07-09 16:39 | 1.9M | |
| small_Logo-with-tagl..> | 2024-07-09 16:40 | 1.9M | |
| SA small_Logo with t..> | 2024-07-09 16:40 | 1.9M | |
| Logo_new_Z.jpg | 2024-07-09 16:40 | 1.8M | |
| 20190516-CED 35th An..> | 2024-07-09 16:39 | 1.7M | |
| IMG_2533.jpg | 2024-07-09 16:39 | 1.6M | |
| businesswoman-cheerf..> | 2024-07-09 16:39 | 1.6M | |
| Adamas-Logo_wTagline..> | 2024-07-09 16:39 | 1.6M | |
| SDH--headshot_0.jpg | 2024-07-09 16:40 | 1.6M | |
| SDH--headshot.jpg | 2024-07-09 16:40 | 1.6M | |
| Sean_Lakind.jpg | 2024-07-09 16:40 | 1.5M | |
| art-board-game-chall..> | 2024-07-09 16:39 | 1.5M | |
| Nick Bradfield do yo..> | 2024-07-09 16:40 | 1.5M | |
| bruvue_logo-1220_ful..> | 2024-07-09 16:39 | 1.5M | |
| bruvue_logo-1220_ful..> | 2024-07-09 16:39 | 1.5M | |
| Andrew_Williams1.jpg | 2024-07-09 16:39 | 1.4M | |
| Willow-Logo.jpg | 2024-07-09 16:40 | 1.4M | |
| JSR-headshot_0.jpg | 2024-07-09 16:40 | 1.4M | |
| JSR-headshot.jpg | 2024-07-09 16:40 | 1.4M | |
| iContact-logo-reg.jpg | 2024-07-09 16:39 | 1.3M | |
| sdh--headshot2.jpg | 2024-07-09 16:40 | 1.3M | |
| AltisLogo_CMYK_HighR..> | 2024-07-09 16:39 | 1.3M | |
| blurred-background-c..> | 2024-07-09 16:39 | 1.2M | |
| Logo V1.jpg | 2024-07-09 16:40 | 1.2M | |
| DP--headshot.jpg | 2024-07-09 16:39 | 1.2M | |
| lindsay_0.JPG | 2024-07-09 16:40 | 1.2M | |
| lindsay.JPG | 2024-07-09 16:40 | 1.2M | |
| jam.jpg | 2024-07-09 16:40 | 1.2M | |
| Funxion_Logo_FullCol..> | 2024-07-09 16:39 | 1.1M | |
| logo_w-tag_CMYK.jpg | 2024-07-09 16:40 | 1.0M | |
| BarfieldLogo-1_0.jpg | 2024-07-09 16:39 | 1.0M | |
| stoolduel-hori-logo.jpg | 2024-07-09 16:40 | 1.0M | |
| revibe technologies ..> | 2024-07-09 16:40 | 1.0M | |
| JSR--headshot_0.jpg | 2024-07-09 16:40 | 1.0M | |
| JSR--headshot.jpg | 2024-07-09 16:40 | 1.0M | |
| 2017 Winners BLC Vit..> | 2024-07-09 16:39 | 1.0M | |
| 302.jpg | 2024-07-09 16:39 | 967K | |
| AEBrandTextLogo_0.jpg | 2024-07-09 16:39 | 966K | |
| AEBrandTextLogo.jpg | 2024-07-09 16:39 | 966K | |
| WWCT_HorzLogo_RGB.jpg | 2024-07-09 16:40 | 955K | |
| Social media graphic..> | 2024-07-09 16:40 | 954K | |
| StrongLogoVert_Light..> | 2024-07-09 16:40 | 951K | |
| StrongLogoVert_Light..> | 2024-07-09 16:40 | 951K | |
| crossing-801713_1920..> | 2024-07-09 16:39 | 948K | |
| drops-of-water-water..> | 2024-07-09 16:39 | 943K | |
| McDonald-York-BC-Log..> | 2024-07-09 16:40 | 928K | |
| EngineOfInnovation_h..> | 2024-07-09 16:39 | 925K | |
| adult-businessman-ca..> | 2024-07-09 16:39 | 914K | |
| MMSTriangleAugust.jpg | 2024-07-09 16:40 | 910K | |
| DSCF0843.JPG | 2024-07-09 16:39 | 905K | |
| salesjam 2 graphic 4..> | 2024-07-09 16:40 | 896K | |
| Be a part of our cul..> | 2024-07-09 16:39 | 895K | |
| LB--headshot_0.jpg | 2024-07-09 16:40 | 869K | |
| LB--headshot.jpg | 2024-07-09 16:40 | 869K | |
| Logo Horizontal.jpg | 2024-07-09 16:40 | 867K | |
| Screen Shot 2019-07-..> | 2024-07-09 16:40 | 860K | |
| EM-headshot.jpg | 2024-07-09 16:39 | 857K | |
| logo_gray_no-tagline..> | 2024-07-09 16:40 | 847K | |
| logo_gray_no-tagline..> | 2024-07-09 16:40 | 847K | |
| logo_gray_no-tagline..> | 2024-07-09 16:40 | 847K | |
| CEDHallOfFameLogo2.jpg | 2024-07-09 16:39 | 841K | |
| 14379667_30757286960..> | 2024-07-09 16:39 | 836K | |
| proposa_BrandBlue (1..> | 2024-07-09 16:40 | 833K | |
| 2019LawSymposium.png | 2024-07-09 16:39 | 816K | |
| DurhamTechSummit.png | 2024-07-09 16:39 | 803K | |
| EngineOfInnovation_h..> | 2024-07-09 16:39 | 790K | |
| Mothers Day Save the..> | 2024-07-09 16:40 | 789K | |
| MobiCompete_FullColo..> | 2024-07-09 16:40 | 783K | |
| MobiCompete_FullColo..> | 2024-07-09 16:40 | 783K | |
| MobiCompete_FullColo..> | 2024-07-09 16:40 | 783K | |
| Insperity_tag_CMYK.jpg | 2024-07-09 16:40 | 779K | |
| analysis-blackboard-..> | 2024-07-09 16:39 | 768K | |
| EWT.PNG | 2024-07-09 16:39 | 757K | |
| Render_Comp_777-200_..> | 2024-07-09 16:40 | 752K | |
| Alcami_Logo_CMYK_H_T..> | 2024-07-09 16:39 | 748K | |
| SEBIO 2019 Apply to ..> | 2024-07-09 16:40 | 748K | |
| [CULTIVATE]-Logo_200..> | 2024-07-09 16:39 | 736K | |
| SpotlightSolar_4C_ci..> | 2024-07-09 16:40 | 723K | |
| ets2017.png | 2024-07-09 16:39 | 708K | |
| Screenshot_5-1.png | 2024-07-09 16:40 | 708K | |
| rti_ia_mark_filled_e..> | 2024-07-09 16:40 | 706K | |
| Navigant_Logo_Color.jpg | 2024-07-09 16:40 | 705K | |
| lsc-v2.jpg | 2024-07-09 16:40 | 699K | |
| fluree_db@4x (1)_0.jpg | 2024-07-09 16:39 | 696K | |
| fluree_db@4x (1).jpg | 2024-07-09 16:39 | 696K | |
| RSMStandardLogoCMYK.jpg | 2024-07-09 16:40 | 691K | |
| WSGR logo color.jpg | 2024-07-09 16:40 | 686K | |
| ClarkstonConsultingL..> | 2024-07-09 16:39 | 685K | |
| HayTag.final_1.jpg | 2024-07-09 16:39 | 681K | |
| HayTag.final_0.jpg | 2024-07-09 16:39 | 681K | |
| HayTag.final.jpg | 2024-07-09 16:39 | 681K | |
| health 20 triangle.jpg | 2024-07-09 16:39 | 675K | |
| EWT 2.PNG | 2024-07-09 16:39 | 673K | |
| FTNCP.jpg | 2024-07-09 16:39 | 667K | |
| Patheon final_logo.jpg | 2024-07-09 16:40 | 662K | |
| Fostering Collaborat..> | 2024-07-09 16:39 | 657K | |
| Untitled design (9).png | 2024-07-09 16:40 | 653K | |
| forrestfirmlogowords..> | 2024-07-09 16:39 | 648K | |
| Purillume Brandmark(..> | 2024-07-09 16:40 | 644K | |
| Purillume Brandmark(..> | 2024-07-09 16:40 | 644K | |
| Color Logo_2.jpg | 2024-07-09 16:39 | 643K | |
| BDO_Color_PMS_Coated..> | 2024-07-09 16:39 | 639K | |
| idea-pitch-backgroun..> | 2024-07-09 16:39 | 633K | |
| BBH Logo color 3.0in..> | 2024-07-09 16:39 | 624K | |
| Screen Shot 2016-09-..> | 2024-07-09 16:40 | 621K | |
| launchuncg_white bac..> | 2024-07-09 16:40 | 619K | |
| Grant Thornton_jpg_l..> | 2024-07-09 16:39 | 614K | |
| Vector2.0.jpg | 2024-07-09 16:40 | 613K | |
| Venture Connect LOGO..> | 2024-07-09 16:40 | 604K | |
| HONGBO_LU0020.png | 2024-07-09 16:39 | 603K | |
| Syneos Health croppe..> | 2024-07-09 16:40 | 598K | |
| lsc-v1 705x705.jpg | 2024-07-09 16:40 | 596K | |
| lsc-v2-website.jpg | 2024-07-09 16:40 | 587K | |
| CED LSC Square Small..> | 2024-07-09 16:39 | 584K | |
| Elliott Davis Logo -..> | 2024-07-09 16:39 | 578K | |
| Greenleaf_Health_Fin..> | 2024-07-09 16:39 | 574K | |
| NCRC Logo 200.jpg | 2024-07-09 16:40 | 573K | |
| Smith Anderson 200 N..> | 2024-07-09 16:40 | 571K | |
| ANNUVA_LOGO_color.jpg | 2024-07-09 16:39 | 570K | |
| DCRI_logo 300.jpg | 2024-07-09 16:39 | 567K | |
| AI-Robby-Allen-02.jpg | 2024-07-09 16:39 | 563K | |
| WSGR-vert-bxw 200x58..> | 2024-07-09 16:40 | 563K | |
| LaunchBio-Invest-in-..> | 2024-07-09 16:40 | 561K | |
| street-371222_1920.jpg | 2024-07-09 16:40 | 559K | |
| square logo_0.jpg | 2024-07-09 16:40 | 557K | |
| square logo.jpg | 2024-07-09 16:40 | 557K | |
| UNC HC Digital Healt..> | 2024-07-09 16:40 | 553K | |
| MMSDurham.jpg | 2024-07-09 16:40 | 548K | |
| LTLS_April.jpg | 2024-07-09 16:40 | 536K | |
| Screen Shot 2018-02-..> | 2024-07-09 16:40 | 533K | |
| image1.JPG | 2024-07-09 16:39 | 532K | |
| pexels-photo-425122.jpg | 2024-07-09 16:40 | 530K | |
| Facebook Event-downs..> | 2024-07-09 16:39 | 526K | |
| LaunchBio_Jan-2019.jpg | 2024-07-09 16:40 | 526K | |
| 1.png | 2024-07-09 16:39 | 523K | |
| SPRINGheader_compres..> | 2024-07-09 16:40 | 522K | |
| life-sciences-banner..> | 2024-07-09 16:40 | 515K | |
| Spoonflower-Gart-Dav..> | 2024-07-09 16:40 | 513K | |
| todd.PNG | 2024-07-09 16:40 | 507K | |
| grinnell logo #2.png | 2024-07-09 16:39 | 506K | |
| Opioid Crisis Graphi..> | 2024-07-09 16:40 | 506K | |
| NewSeedFin2_0.jpg | 2024-07-09 16:40 | 491K | |
| NewSeedFin2.jpg | 2024-07-09 16:40 | 491K | |
| Mark Easley 2015.jpg | 2024-07-09 16:40 | 487K | |
| _Summer Social_Ag Fo..> | 2024-07-09 16:39 | 483K | |
| final CED Infographi..> | 2024-07-09 16:39 | 483K | |
| final CED Infographi..> | 2024-07-09 16:39 | 483K | |
| ProduceBox-Courtney-..> | 2024-07-09 16:40 | 480K | |
| iScribes450x450.png | 2024-07-09 16:40 | 474K | |
| Eventbrite_Header_Ma..> | 2024-07-09 16:39 | 469K | |
| Sept network meetup ..> | 2024-07-09 16:40 | 465K | |
| MMSTriangle-11-20-18..> | 2024-07-09 16:40 | 453K | |
| Chiesi_Logo_Cyan.jpg | 2024-07-09 16:39 | 453K | |
| MMSTriangle-10-16-18..> | 2024-07-09 16:40 | 452K | |
| city-593145_1920.jpg | 2024-07-09 16:39 | 452K | |
| MMSTriangle-1-15-19.jpg | 2024-07-09 16:40 | 450K | |
| 2016.09.26_Nest_Beer..> | 2024-07-09 16:39 | 441K | |
| MMS-Triangle-9-18-18..> | 2024-07-09 16:40 | 441K | |
| FB - Events (1).png | 2024-07-09 16:39 | 440K | |
| September 2016_Page_..> | 2024-07-09 16:40 | 431K | |
| Copy of network meet..> | 2024-07-09 16:39 | 427K | |
| jwm consulting semin..> | 2024-07-09 16:40 | 427K | |
| LB_SquarePost_March.jpg | 2024-07-09 16:40 | 424K | |
| bac_lo1_rgb_ust_150d..> | 2024-07-09 16:39 | 423K | |
| _18-271_AG-Forum-iSt..> | 2024-07-09 16:39 | 419K | |
| PodKeeper_logo.jpg | 2024-07-09 16:40 | 416K | |
| Low Res JPEG-4527.jpg | 2024-07-09 16:40 | 415K | |
| NCBABS-Emerging Biot..> | 2024-07-09 16:40 | 413K | |
| IS19-eventDates-1200..> | 2024-07-09 16:40 | 413K | |
| Innovate Durham Logo..> | 2024-07-09 16:40 | 412K | |
| Innovate Durham Logo..> | 2024-07-09 16:40 | 412K | |
| Nick Jordan.jpg | 2024-07-09 16:40 | 405K | |
| EY_Logo_Beam_Tag_Sta..> | 2024-07-09 16:39 | 403K | |
| EY_Logo_Beam_Tag_Sta..> | 2024-07-09 16:39 | 403K | |
| Innovate Durham Logo..> | 2024-07-09 16:40 | 401K | |
| Eventbrite Image.png | 2024-07-09 16:39 | 397K | |
| congressman's event.jpg | 2024-07-09 16:39 | 393K | |
| #sg150 - FB Cover.jpg | 2024-07-09 16:39 | 390K | |
| i2_Square_0.jpg | 2024-07-09 16:39 | 389K | |
| worklifeintegration.png | 2024-07-09 16:40 | 383K | |
| network meet-up no s..> | 2024-07-09 16:40 | 381K | |
| RegionalMap.png | 2024-07-09 16:40 | 380K | |
| pexels-photo-443383.jpg | 2024-07-09 16:40 | 379K | |
| GAMLLC 2016 NC Fiduc..> | 2024-07-09 16:39 | 377K | |
| BAKS Clothing Co. (1..> | 2024-07-09 16:39 | 373K | |
| Low Res JPEG-5940.jpg | 2024-07-09 16:40 | 373K | |
| Capture.PNG | 2024-07-09 16:39 | 365K | |
| 2017-North-Carolina-..> | 2024-07-09 16:39 | 365K | |
| byrony_0.PNG | 2024-07-09 16:39 | 352K | |
| Resized Logo_1.png | 2024-07-09 16:40 | 350K | |
| Resized Logo_0.png | 2024-07-09 16:40 | 350K | |
| Resized Logo.png | 2024-07-09 16:40 | 350K | |
| Pitch_CED.png | 2024-07-09 16:40 | 349K | |
| Screen Shot 2018-03-..> | 2024-07-09 16:40 | 347K | |
| LB_SquarePost_Februa..> | 2024-07-09 16:40 | 344K | |
| Max Profile 201608.jpg | 2024-07-09 16:40 | 342K | |
| pexels-photo-136419.jpg | 2024-07-09 16:40 | 342K | |
| 2018 LSC Recap Page ..> | 2024-07-09 16:39 | 339K | |
| Stealz450x450.png | 2024-07-09 16:40 | 334K | |
| Arie Belldegrun Phot..> | 2024-07-09 16:39 | 330K | |
| SiNON_Therapeutics_L..> | 2024-07-09 16:40 | 329K | |
| SUP-Header-image-Log..> | 2024-07-09 16:40 | 321K | |
| John Carryrou_0.png | 2024-07-09 16:40 | 320K | |
| IDEA Fund Partners 2..> | 2024-07-09 16:39 | 310K | |
| ProAxion-black_w_tag..> | 2024-07-09 16:40 | 309K | |
| cio_digital_transfor..> | 2024-07-09 16:39 | 306K | |
| IR October Meetup 20..> | 2024-07-09 16:40 | 303K | |
| events-banner.jpg | 2024-07-09 16:39 | 303K | |
| NZ_Primary_Purple_RG..> | 2024-07-09 16:40 | 299K | |
| CED500.jpg | 2024-07-09 16:39 | 299K | |
| carol head shot.jpg | 2024-07-09 16:39 | 296K | |
| LaunchBio_LinkedIn_I..> | 2024-07-09 16:40 | 293K | |
| PNGfacebook-cover-te..> | 2024-07-09 16:40 | 286K | |
| terrence_wells_450.png | 2024-07-09 16:40 | 285K | |
| Pete Kofod.jpg | 2024-07-09 16:40 | 282K | |
| HBA logo.jpg | 2024-07-09 16:39 | 278K | |
| MMSTriangle-2-19-19.jpg | 2024-07-09 16:40 | 278K | |
| LTLS_201806_500x500.jpg | 2024-07-09 16:40 | 278K | |
| final_file_the_bib_l..> | 2024-07-09 16:39 | 273K | |
| FINAL FILE THE BIB L..> | 2024-07-09 16:39 | 273K | |
| FINAL FILE THE BIB L..> | 2024-07-09 16:39 | 273K | |
| FINAL FILE THE BIB L..> | 2024-07-09 16:39 | 273K | |
| FINAL FILE THE BIB L..> | 2024-07-09 16:39 | 273K | |
| Be a Rock Star_0.jpg | 2024-07-09 16:39 | 273K | |
| Phononic_9393_2x2.5@..> | 2024-07-09 16:40 | 268K | |
| SERC conference logo..> | 2024-07-09 16:40 | 268K | |
| weed cocco.PNG | 2024-07-09 16:40 | 264K | |
| Screen Shot 2018-04-..> | 2024-07-09 16:40 | 261K | |
| rtrp.png | 2024-07-09 16:40 | 254K | |
| Screen Shot 2017-10-..> | 2024-07-09 16:40 | 253K | |
| microphone-298587_12..> | 2024-07-09 16:40 | 252K | |
| Dan D'Aquisto.jpg | 2024-07-09 16:39 | 251K | |
| accelerate three.jpg | 2024-07-09 16:39 | 248K | |
| header.png | 2024-07-09 16:39 | 247K | |
| 1MC_Horiz_RGB_1.jpg | 2024-07-09 16:39 | 247K | |
| 1MC_Horiz_RGB_0.jpg | 2024-07-09 16:39 | 247K | |
| 1MC_Horiz_RGB.jpg | 2024-07-09 16:39 | 247K | |
| Untitled design (2).png | 2024-07-09 16:40 | 242K | |
| Flyer Sponsorships I..> | 2024-07-09 16:39 | 241K | |
| Jayson.PNG | 2024-07-09 16:40 | 240K | |
| pexels-photo-705792_..> | 2024-07-09 16:40 | 238K | |
| pexels-photo-705792.jpg | 2024-07-09 16:40 | 238K | |
| Tannan Vinay 0116_pr..> | 2024-07-09 16:40 | 238K | |
| MMSTriangle-6-18-19.jpg | 2024-07-09 16:40 | 238K | |
| xocolat atelier-3.png | 2024-07-09 16:40 | 236K | |
| Picture1.png | 2024-07-09 16:40 | 234K | |
| headshot.png | 2024-07-09 16:39 | 231K | |
| MMSTriangle-generic-..> | 2024-07-09 16:40 | 230K | |
| Homepage Networking ..> | 2024-07-09 16:39 | 230K | |
| Pappas Capital_25th_..> | 2024-07-09 16:40 | 230K | |
| Tellus logo.jpg | 2024-07-09 16:40 | 221K | |
| Crowdfunder @ Pinkub..> | 2024-07-09 16:39 | 220K | |
| Womack Attack_RTP.png | 2024-07-09 16:40 | 220K | |
| EY_logo_1.png | 2024-07-09 16:39 | 216K | |
| EY_logo_0.png | 2024-07-09 16:39 | 216K | |
| 092-XL.jpg | 2024-07-09 16:39 | 215K | |
| steven.PNG | 2024-07-09 16:40 | 214K | |
| 093-XL.jpg | 2024-07-09 16:39 | 213K | |
| student 1_0.PNG | 2024-07-09 16:40 | 212K | |
| trianglestartupsocia..> | 2024-07-09 16:40 | 212K | |
| MAA Laboratories_v1_..> | 2024-07-09 16:40 | 212K | |
| Figure Your Sh_t Out..> | 2024-07-09 16:39 | 212K | |
| Twitter_Image_Octobe..> | 2024-07-09 16:40 | 212K | |
| NCCapitol940x450.jpg | 2024-07-09 16:40 | 207K | |
| Screen Shot 2017-08-..> | 2024-07-09 16:40 | 207K | |
| squeedeal_fin-01 (1)..> | 2024-07-09 16:40 | 205K | |
| PP-Logo_JPEG - (Digi..> | 2024-07-09 16:40 | 204K | |
| ResiSpeak Inc Logo.png | 2024-07-09 16:40 | 204K | |
| Sandesh Joshi Headsh..> | 2024-07-09 16:40 | 204K | |
| Dualogics Logo.png | 2024-07-09 16:39 | 204K | |
| mepic.jpg | 2024-07-09 16:40 | 203K | |
| popup_sept6.jpg | 2024-07-09 16:40 | 202K | |
| digital marketing in..> | 2024-07-09 16:39 | 202K | |
| digital marketing in..> | 2024-07-09 16:39 | 202K | |
| Copy of Figure Your ..> | 2024-07-09 16:39 | 202K | |
| DavisMoore-logo(high..> | 2024-07-09 16:39 | 201K | |
| panel1.jpg | 2024-07-09 16:40 | 201K | |
| Ravila Gupta circle ..> | 2024-07-09 16:40 | 201K | |
| Mike Doernberg.jpg | 2024-07-09 16:40 | 201K | |
| NCBA Ugly Sweater.jpg | 2024-07-09 16:40 | 199K | |
| helpfest_8.6.18_Sq.jpg | 2024-07-09 16:39 | 199K | |
| Screen Shot 2018-05-..> | 2024-07-09 16:40 | 196K | |
| trianglestartupsocia..> | 2024-07-09 16:40 | 195K | |
| elizabethyins_0.png | 2024-07-09 16:39 | 194K | |
| Final Event Header.png | 2024-07-09 16:39 | 193K | |
| Thank you - Seal - S..> | 2024-07-09 16:40 | 192K | |
| Stealz_Cumberpatch_H..> | 2024-07-09 16:40 | 192K | |
| digital health confe..> | 2024-07-09 16:39 | 191K | |
| Top Sponsors (2018).jpg | 2024-07-09 16:40 | 189K | |
| thriveconference4.jpg | 2024-07-09 16:40 | 189K | |
| about-ced_1.jpg | 2024-07-09 16:39 | 189K | |
| about-ced_0.jpg | 2024-07-09 16:39 | 189K | |
| Collage.png | 2024-07-09 16:39 | 188K | |
| Duchess Health Logo ..> | 2024-07-09 16:39 | 188K | |
| Logo copy.jpg | 2024-07-09 16:40 | 186K | |
| Twitter_Image_Holida..> | 2024-07-09 16:40 | 186K | |
| trinet_logo_large.jpg | 2024-07-09 16:40 | 185K | |
| TriNet_Logo_Ambition..> | 2024-07-09 16:40 | 185K | |
| Jason Caplain -Heads..> | 2024-07-09 16:40 | 185K | |
| Eventbrite logo only..> | 2024-07-09 16:39 | 182K | |
| Eventbrite logo only..> | 2024-07-09 16:39 | 182K | |
| LB_Twitter_September..> | 2024-07-09 16:40 | 182K | |
| Chris_0.png | 2024-07-09 16:39 | 180K | |
| full_2015812_1.jpg | 2024-07-09 16:39 | 180K | |
| pexels-photo-392018_..> | 2024-07-09 16:40 | 179K | |
| EY_Logo_Beam_Tag_Sta..> | 2024-07-09 16:39 | 177K | |
| Gustofson_0.PNG | 2024-07-09 16:39 | 176K | |
| Capital-Bank-First-T..> | 2024-07-09 16:39 | 174K | |
| Deep Blue logo_final..> | 2024-07-09 16:39 | 174K | |
| ARD.jpg | 2024-07-09 16:39 | 172K | |
| Primary-Stacked_Find..> | 2024-07-09 16:40 | 170K | |
| TechWire-ExecExchang..> | 2024-07-09 16:40 | 170K | |
| Centennial Parking.jpg | 2024-07-09 16:39 | 169K | |
| BofA US Trust.jpg | 2024-07-09 16:39 | 168K | |
| SCBIO-Logo-2013-outl..> | 2024-07-09 16:40 | 167K | |
| Donald Thompson.jpg | 2024-07-09 16:39 | 163K | |
| CEDStaffWide.jpg | 2024-07-09 16:39 | 162K | |
| LinkedIn_April_LTLS.jpg | 2024-07-09 16:40 | 162K | |
| RIoT WR July 10 Even..> | 2024-07-09 16:40 | 162K | |
| ACCELERATE web thumb..> | 2024-07-09 16:39 | 162K | |
| LES logo.png | 2024-07-09 16:40 | 162K | |
| 500x500.png | 2024-07-09 16:39 | 162K | |
| KAP.jpg | 2024-07-09 16:40 | 161K | |
| Twitter_LaunchBio_Ju..> | 2024-07-09 16:40 | 160K | |
| Headline Sponsor _0.jpg | 2024-07-09 16:39 | 158K | |
| Venture Connect LOGO..> | 2024-07-09 16:40 | 157K | |
| maxresdefault_0.jpg | 2024-07-09 16:40 | 157K | |
| maxresdefault.jpg | 2024-07-09 16:40 | 157K | |
| cedlsc01_024_0.JPG | 2024-07-09 16:39 | 154K | |
| Nest.png | 2024-07-09 16:40 | 154K | |
| Picture3.png | 2024-07-09 16:40 | 154K | |
| Headline Sponsor .jpg | 2024-07-09 16:39 | 153K | |
| AU Awards.jpg | 2024-07-09 16:39 | 153K | |
| Lum DTx Color.png | 2024-07-09 16:40 | 149K | |
| P10_Cmyk_Blue_r-trad..> | 2024-07-09 16:40 | 149K | |
| P10_Cmyk_Blue_r-trad..> | 2024-07-09 16:40 | 149K | |
| P10_Cmyk_Blue_r-trad..> | 2024-07-09 16:40 | 149K | |
| CERCA Tagline.png | 2024-07-09 16:39 | 148K | |
| CentreOne-logo-full-..> | 2024-07-09 16:39 | 147K | |
| JP Headshot.jpg | 2024-07-09 16:40 | 147K | |
| Metlife-techstars-de..> | 2024-07-09 16:40 | 147K | |
| Joseph Cochrane-Brow..> | 2024-07-09 16:40 | 147K | |
| symm.png | 2024-07-09 16:40 | 146K | |
| NV Symbol 512.jpg | 2024-07-09 16:40 | 146K | |
| path8.png | 2024-07-09 16:40 | 145K | |
| Square - Internation..> | 2024-07-09 16:40 | 145K | |
| VitalFlo_HorizontalL..> | 2024-07-09 16:40 | 145K | |
| LB_SquarePost_May.jpg | 2024-07-09 16:40 | 144K | |
| SBIR Tech Commercial..> | 2024-07-09 16:40 | 143K | |
| TVCWebsiteDownSlide.jpg | 2024-07-09 16:40 | 143K | |
| pexels-photo-256262.jpg | 2024-07-09 16:40 | 143K | |
| student 2_0.PNG | 2024-07-09 16:40 | 141K | |
| dna-1811955_1280.jpg | 2024-07-09 16:39 | 139K | |
| 18774534761_20751cce..> | 2024-07-09 16:39 | 138K | |
| Diamond Logo_Blue_Ve..> | 2024-07-09 16:39 | 136K | |
| Jon Hayes_0.jpg | 2024-07-09 16:40 | 135K | |
| Jon Hayes.jpg | 2024-07-09 16:40 | 135K | |
| Flucelvax QIV logo_R..> | 2024-07-09 16:39 | 135K | |
| pnc_color.jpg | 2024-07-09 16:40 | 134K | |
| Wolpert364.png | 2024-07-09 16:40 | 134K | |
| wsblacklogo.jpg | 2024-07-09 16:40 | 134K | |
| Event Thumb 500x500.jpg | 2024-07-09 16:39 | 133K | |
| Tech Breakfast.png | 2024-07-09 16:40 | 131K | |
| pexels-photo-267596.jpg | 2024-07-09 16:40 | 131K | |
| lsc.jpg | 2024-07-09 16:40 | 131K | |
| swellsystems.png | 2024-07-09 16:40 | 129K | |
| victoria.png | 2024-07-09 16:40 | 128K | |
| Tech Venture 2017 In..> | 2024-07-09 16:40 | 128K | |
| brain-and-caption_or..> | 2024-07-09 16:39 | 128K | |
| 002-XL.jpg | 2024-07-09 16:39 | 127K | |
| Biltmore1.jpg | 2024-07-09 16:39 | 127K | |
| ML_BAC_logo.png | 2024-07-09 16:40 | 127K | |
| StoryInvite2.jpg | 2024-07-09 16:40 | 125K | |
| H_TrillAI_Logo_Large..> | 2024-07-09 16:39 | 124K | |
| MB_Logo_RGB_300DPI.jpg | 2024-07-09 16:40 | 122K | |
| Patheon Logo_1.png | 2024-07-09 16:40 | 122K | |
| Patheon Logo_0.png | 2024-07-09 16:40 | 122K | |
| Patheon Logo.png | 2024-07-09 16:40 | 122K | |
| Image-1.jpg | 2024-07-09 16:39 | 121K | |
| New Date Banner.jpg | 2024-07-09 16:40 | 119K | |
| Behbahani 350x350.jpg | 2024-07-09 16:39 | 118K | |
| Deals for Homepage.jpg | 2024-07-09 16:39 | 116K | |
| IR+Summit2017_placeh..> | 2024-07-09 16:40 | 116K | |
| Dan_Lyons_color_crop..> | 2024-07-09 16:39 | 115K | |
| 21371409_14039271363..> | 2024-07-09 16:39 | 114K | |
| Exit Strategies Reca..> | 2024-07-09 16:39 | 114K | |
| ICF Raleigh Conferen..> | 2024-07-09 16:39 | 113K | |
| DSCF0129.JPG | 2024-07-09 16:39 | 113K | |
| HonorAuctionThumbnai..> | 2024-07-09 16:39 | 113K | |
| Innovation Room 2, C..> | 2024-07-09 16:40 | 112K | |
| MusterRDU.png | 2024-07-09 16:40 | 112K | |
| WSGR .jpg | 2024-07-09 16:40 | 110K | |
| luan.jpg | 2024-07-09 16:40 | 110K | |
| Bradley-FullName-log..> | 2024-07-09 16:39 | 110K | |
| InnovateRaleighSummi..> | 2024-07-09 16:40 | 108K | |
| OFS Postcard17 Back_..> | 2024-07-09 16:40 | 108K | |
| revealmobilelogo.png | 2024-07-09 16:40 | 107K | |
| i2-2019-squareimage.jpg | 2024-07-09 16:39 | 107K | |
| Fall-2019-Raleigh-In..> | 2024-07-09 16:39 | 107K | |
| iContact-Pro-logo.png | 2024-07-09 16:39 | 107K | |
| Venture Hacked Thumb..> | 2024-07-09 16:40 | 106K | |
| Jon_Rennie_Business_..> | 2024-07-09 16:40 | 106K | |
| Brian Onorio.jpg | 2024-07-09 16:39 | 106K | |
| Carb-x.jpg | 2024-07-09 16:39 | 106K | |
| TechConference800x51..> | 2024-07-09 16:40 | 105K | |
| kristina sandine_1.png | 2024-07-09 16:40 | 104K | |
| kristina sandine_0.png | 2024-07-09 16:40 | 104K | |
| SportCourt.JPG | 2024-07-09 16:40 | 104K | |
| for website 3.jpg | 2024-07-09 16:39 | 103K | |
| EngineOfInnovation_L..> | 2024-07-09 16:39 | 103K | |
| EngineOfInnovation_L..> | 2024-07-09 16:39 | 103K | |
| EngineOfInnovation_L..> | 2024-07-09 16:39 | 103K | |
| AnelleO Logo v1_0.png | 2024-07-09 16:39 | 103K | |
| AnelleO Logo v1.png | 2024-07-09 16:39 | 103K | |
| Dan Ariely Crop.jpg | 2024-07-09 16:39 | 103K | |
| pexels-photo-735911...> | 2024-07-09 16:40 | 102K | |
| full_2015812_0.jpg | 2024-07-09 16:39 | 101K | |
| full_2015812.jpg | 2024-07-09 16:39 | 101K | |
| UVISION-Logo-FINAL-R..> | 2024-07-09 16:40 | 101K | |
| tech-conf-banner_0.jpg | 2024-07-09 16:40 | 101K | |
| tech-conf-banner.jpg | 2024-07-09 16:40 | 101K | |
| cloudgiants-socialsh..> | 2024-07-09 16:39 | 101K | |
| Meetup 500x500.png | 2024-07-09 16:40 | 101K | |
| HQCode.png | 2024-07-09 16:39 | 100K | |
| pexels-photo-64057.jpg | 2024-07-09 16:40 | 99K | |
| GAMlogo(jpeg)2813.jpg | 2024-07-09 16:39 | 98K | |
| full_2015812.png | 2024-07-09 16:39 | 98K | |
| Screen Shot 2016-09-..> | 2024-07-09 16:40 | 98K | |
| Triangle-BABCNC-logo..> | 2024-07-09 16:40 | 97K | |
| pexels-photo-257930.jpg | 2024-07-09 16:40 | 97K | |
| ncstate-brick-2x2-re..> | 2024-07-09 16:40 | 96K | |
| Toastmasters.jpg | 2024-07-09 16:40 | 96K | |
| https---cdn.evbuc_.c..> | 2024-07-09 16:39 | 96K | |
| Infina-Logo-RGB 2018..> | 2024-07-09 16:39 | 95K | |
| jobfairupdatedlogo.jpg | 2024-07-09 16:40 | 95K | |
| rev rec 500x500 for ..> | 2024-07-09 16:40 | 94K | |
| c&w_0.png | 2024-07-09 16:39 | 93K | |
| WSGR bootcamp.jpg | 2024-07-09 16:40 | 93K | |
| banner_4.jpg | 2024-07-09 16:39 | 93K | |
| banner_3.jpg | 2024-07-09 16:39 | 93K | |
| banner_2.jpg | 2024-07-09 16:39 | 93K | |
| banner_1.jpg | 2024-07-09 16:39 | 93K | |
| banner_0.jpg | 2024-07-09 16:39 | 93K | |
| banner.jpg | 2024-07-09 16:39 | 93K | |
| LSForum logo.jpg | 2024-07-09 16:40 | 93K | |
| MEDIC Professional F..> | 2024-07-09 16:40 | 92K | |
| blockchain worksop.JPG | 2024-07-09 16:39 | 92K | |
| path.png | 2024-07-09 16:40 | 92K | |
| IMG_1925_2.JPG | 2024-07-09 16:39 | 91K | |
| IMG_1925_1.JPG | 2024-07-09 16:39 | 91K | |
| IMG_1925_0.JPG | 2024-07-09 16:39 | 91K | |
| IMG_1925.JPG | 2024-07-09 16:39 | 91K | |
| Provider Panel.jpg | 2024-07-09 16:40 | 90K | |
| MedTech Innovator.jpg | 2024-07-09 16:40 | 90K | |
| SG_Facebook_Logo_Squ..> | 2024-07-09 16:40 | 89K | |
| cleantech connect gl..> | 2024-07-09 16:39 | 89K | |
| Donnelley.jpg | 2024-07-09 16:39 | 89K | |
| Meetup Holiday 500x5..> | 2024-07-09 16:40 | 88K | |
| LautDesignMLautHeads..> | 2024-07-09 16:40 | 88K | |
| Telecommute_Camps.jpg | 2024-07-09 16:40 | 88K | |
| pexels-photo-1194713..> | 2024-07-09 16:40 | 88K | |
| Freada Kapor Klein H..> | 2024-07-09 16:39 | 88K | |
| InternetOfThingsShow..> | 2024-07-09 16:40 | 88K | |
| BrettII.jpg | 2024-07-09 16:39 | 88K | |
| Organize for Success..> | 2024-07-09 16:40 | 87K | |
| Caroline Fairchild C..> | 2024-07-09 16:39 | 86K | |
| Joe DeSimone cropped..> | 2024-07-09 16:40 | 85K | |
| Logo Tall on Orange.jpg | 2024-07-09 16:40 | 85K | |
| tech-venture.jpg | 2024-07-09 16:40 | 84K | |
| Mark Velleca.jpg | 2024-07-09 16:40 | 84K | |
| Plakous-Logo-1.png | 2024-07-09 16:40 | 84K | |
| VL Logo with TagLine..> | 2024-07-09 16:40 | 84K | |
| NuPulseCV 2019 LOGO.jpg | 2024-07-09 16:40 | 84K | |
| Investor Image Blue ..> | 2024-07-09 16:40 | 83K | |
| Organize for Success..> | 2024-07-09 16:40 | 83K | |
| Organize for Success..> | 2024-07-09 16:40 | 83K | |
| Alisyn Malek cropped..> | 2024-07-09 16:39 | 83K | |
| JPMorgan Pic.jpg | 2024-07-09 16:40 | 83K | |
| Laura Deming.jpg | 2024-07-09 16:40 | 82K | |
| LemnaTech Image 400x..> | 2024-07-09 16:40 | 82K | |
| Vanessa Larco Headsh..> | 2024-07-09 16:40 | 82K | |
| Khayrallah-DSCF7639_..> | 2024-07-09 16:40 | 81K | |
| Khayrallah-DSCF7639_..> | 2024-07-09 16:40 | 81K | |
| Khayrallah-DSCF7639.jpg | 2024-07-09 16:40 | 81K | |
| Christy-Shaffer-8077..> | 2024-07-09 16:39 | 81K | |
| SmithAndersonNEW10.3..> | 2024-07-09 16:40 | 81K | |
| DHG_logo (RGB).jpg | 2024-07-09 16:39 | 81K | |
| dave.jpg | 2024-07-09 16:39 | 81K | |
| saber_0.jpg | 2024-07-09 16:40 | 81K | |
| ITA-Emblem.png | 2024-07-09 16:40 | 81K | |
| saber.jpg | 2024-07-09 16:40 | 80K | |
| Growth Workshop Logo..> | 2024-07-09 16:39 | 80K | |
| John Doerr 375.jpg | 2024-07-09 16:40 | 79K | |
| November_520px.JPG | 2024-07-09 16:40 | 78K | |
| Atlanticheader3.jpg | 2024-07-09 16:39 | 78K | |
| River_Cities_lrg.jpg | 2024-07-09 16:40 | 78K | |
| PacificWesternBank_v..> | 2024-07-09 16:40 | 77K | |
| IMG_4007 466x350.jpg | 2024-07-09 16:39 | 77K | |
| IBM-logo.jpg | 2024-07-09 16:39 | 77K | |
| Venture-Atlanta3-113..> | 2024-07-09 16:40 | 76K | |
| barcentercircle_gate..> | 2024-07-09 16:39 | 75K | |
| Neal Fowler_0.jpg | 2024-07-09 16:40 | 75K | |
| SPONSOR FRONT PAGE.JPG | 2024-07-09 16:40 | 75K | |
| LB_SquarePost_AllSpo..> | 2024-07-09 16:40 | 75K | |
| capel.jpg | 2024-07-09 16:39 | 75K | |
| DukeInnovation.png | 2024-07-09 16:39 | 74K | |
| Kevin Smith 375.jpg | 2024-07-09 16:40 | 74K | |
| mason.jpg | 2024-07-09 16:40 | 73K | |
| untitled-145 Squared..> | 2024-07-09 16:40 | 73K | |
| CMS logo - blue vers..> | 2024-07-09 16:39 | 73K | |
| LDR Brews_0.jpg | 2024-07-09 16:40 | 73K | |
| LDR Brews.jpg | 2024-07-09 16:40 | 73K | |
| Matthew_Kane.jpg | 2024-07-09 16:40 | 73K | |
| conference-images-sm..> | 2024-07-09 16:39 | 73K | |
| stridebio.jpg | 2024-07-09 16:40 | 73K | |
| IBM-logolarge.jpg | 2024-07-09 16:39 | 73K | |
| Soil 400px x 400 px.jpg | 2024-07-09 16:40 | 73K | |
| Netsertive.png | 2024-07-09 16:40 | 72K | |
| Khayrallah-DSCF7639_..> | 2024-07-09 16:40 | 72K | |
| BABCTriangleNCchapte..> | 2024-07-09 16:39 | 72K | |
| BABCTriangleNCchapte..> | 2024-07-09 16:39 | 72K | |
| contracthound-logo.png | 2024-07-09 16:39 | 72K | |
| MEDIC.png | 2024-07-09 16:40 | 71K | |
| IQVIA Horizontal Lo..> | 2024-07-09 16:40 | 71K | |
| Edgerton.png | 2024-07-09 16:39 | 71K | |
| Vinay Raman - headsh..> | 2024-07-09 16:40 | 70K | |
| Pompe Video.jpg | 2024-07-09 16:40 | 70K | |
| ITARC Logo (Vertical..> | 2024-07-09 16:40 | 69K | |
| headshot_jim.jpg | 2024-07-09 16:39 | 69K | |
| Produce Box Oct 2017..> | 2024-07-09 16:40 | 68K | |
| Digital Transformati..> | 2024-07-09 16:39 | 68K | |
| CHAPS1.jpg | 2024-07-09 16:39 | 68K | |
| digimarcon-world-201..> | 2024-07-09 16:39 | 67K | |
| American Underground..> | 2024-07-09 16:39 | 67K | |
| SG_Facebook_Logo_Squ..> | 2024-07-09 16:40 | 67K | |
| SG_Facebook_Logo_Squ..> | 2024-07-09 16:40 | 67K | |
| SG_Facebook_Logo_Squ..> | 2024-07-09 16:40 | 67K | |
| SG_Facebook_Logo_Squ..> | 2024-07-09 16:40 | 67K | |
| SG_Facebook_Logo_Squ..> | 2024-07-09 16:40 | 67K | |
| SG_Facebook_Logo_Squ..> | 2024-07-09 16:40 | 67K | |
| SG_Facebook_Logo_Squ..> | 2024-07-09 16:40 | 67K | |
| SG_Facebook_Logo_Squ..> | 2024-07-09 16:40 | 67K | |
| SG_Facebook_Logo_Squ..> | 2024-07-09 16:40 | 67K | |
| SG_Facebook_Logo_Squ..> | 2024-07-09 16:40 | 67K | |
| Growth Company - Ton..> | 2024-07-09 16:39 | 67K | |
| GX-Gold-Participant-..> | 2024-07-09 16:39 | 67K | |
| pendomonium_2019.png | 2024-07-09 16:40 | 67K | |
| element451 logo.png | 2024-07-09 16:39 | 66K | |
| Growth Company - Ani..> | 2024-07-09 16:39 | 65K | |
| GWL logo.png | 2024-07-09 16:39 | 65K | |
| Slide3.JPG | 2024-07-09 16:40 | 65K | |
| Brown_Brothers_Harri..> | 2024-07-09 16:39 | 65K | |
| Slide4_0.JPG | 2024-07-09 16:40 | 65K | |
| Slide4.JPG | 2024-07-09 16:40 | 65K | |
| TECHB.jpg | 2024-07-09 16:40 | 64K | |
| Patricia Nakache Hea..> | 2024-07-09 16:40 | 64K | |
| 2018 Women in Tech.jpg | 2024-07-09 16:39 | 64K | |
| Drew Schiller - 350x..> | 2024-07-09 16:39 | 63K | |
| Chasen 475x475.jpg | 2024-07-09 16:39 | 63K | |
| Slide5.JPG | 2024-07-09 16:40 | 63K | |
| megamixer.jpg | 2024-07-09 16:40 | 63K | |
| Slide2.JPG | 2024-07-09 16:40 | 62K | |
| Zaloni450x450.jpg | 2024-07-09 16:40 | 62K | |
| HiggsBoson@3x_0.png | 2024-07-09 16:39 | 62K | |
| HiggsBoson@3x.png | 2024-07-09 16:39 | 62K | |
| kristina sandine_2.png | 2024-07-09 16:40 | 62K | |
| slide1.jpg | 2024-07-09 16:40 | 61K | |
| SEfintechVC 2018 Bla..> | 2024-07-09 16:40 | 61K | |
| Pendo.jpg | 2024-07-09 16:40 | 61K | |
| Hugh Wrigley 375.jpg | 2024-07-09 16:39 | 61K | |
| EntrepreneurStoryBRI..> | 2024-07-09 16:39 | 61K | |
| TOPO.jpg | 2024-07-09 16:40 | 60K | |
| kristina sandine.png | 2024-07-09 16:40 | 60K | |
| Julie Freischlag 350..> | 2024-07-09 16:40 | 60K | |
| Lindy Bio logo (1).jpg | 2024-07-09 16:40 | 60K | |
| Kevin Tunick 375.jpg | 2024-07-09 16:40 | 60K | |
| Stephen Fraser 350x4..> | 2024-07-09 16:40 | 60K | |
| Brendan.jpg | 2024-07-09 16:39 | 60K | |
| LexisNexis logo_0.png | 2024-07-09 16:40 | 60K | |
| ir wesite.jpg | 2024-07-09 16:40 | 60K | |
| Screen Shot 2018-03-..> | 2024-07-09 16:40 | 60K | |
| cnex_logo.png | 2024-07-09 16:39 | 60K | |
| https___cdn.evbuc_.c..> | 2024-07-09 16:39 | 59K | |
| David Cohen 350.jpg | 2024-07-09 16:39 | 59K | |
| Fred Eshelman 350x35..> | 2024-07-09 16:39 | 59K | |
| Keratin_Logo_RGB-102..> | 2024-07-09 16:40 | 59K | |
| ira egg _0.jpg | 2024-07-09 16:40 | 59K | |
| ira egg .jpg | 2024-07-09 16:40 | 59K | |
| Mel Williams 375.jpg | 2024-07-09 16:40 | 59K | |
| Priya Kishnani 350x3..> | 2024-07-09 16:40 | 58K | |
| CindyWhiteheadHeadsh..> | 2024-07-09 16:39 | 58K | |
| June2016SlamFlyer.PNG | 2024-07-09 16:40 | 58K | |
| revibe_technologies_..> | 2024-07-09 16:40 | 58K | |
| Right_Management_Sep..> | 2024-07-09 16:40 | 58K | |
| image.png | 2024-07-09 16:39 | 57K | |
| Governor Roy Cooper ..> | 2024-07-09 16:39 | 57K | |
| Secretary-Copeland 3..> | 2024-07-09 16:40 | 57K | |
| Kelly Smith - 350x35..> | 2024-07-09 16:40 | 57K | |
| RTP Event_500x500.png | 2024-07-09 16:40 | 57K | |
| Clara Sieg_Headshot.jpg | 2024-07-09 16:39 | 56K | |
| Show Me the Money Sq..> | 2024-07-09 16:40 | 56K | |
| NACD_RTC_LOGO 6-5-13..> | 2024-07-09 16:40 | 55K | |
| Velleca 350x350.jpg | 2024-07-09 16:40 | 55K | |
| MFS Logo - FULL LOGO..> | 2024-07-09 16:40 | 55K | |
| Ideafest Logo RGB-01..> | 2024-07-09 16:39 | 55K | |
| Ideafest Logo RGB-01..> | 2024-07-09 16:39 | 55K | |
| LB_Twitter_September..> | 2024-07-09 16:40 | 55K | |
| Jennifer Kaelin.jpg | 2024-07-09 16:40 | 55K | |
| Steve Nelson Headsho..> | 2024-07-09 16:40 | 55K | |
| IdeaFest Logo_1.png | 2024-07-09 16:39 | 54K | |
| IdeaFest Logo_0.png | 2024-07-09 16:39 | 54K | |
| IdeaFest Logo.png | 2024-07-09 16:39 | 54K | |
| Sue Van 350x350.jpg | 2024-07-09 16:40 | 54K | |
| Caplain400x400.jpg | 2024-07-09 16:39 | 54K | |
| Robbie Allen 351x350..> | 2024-07-09 16:40 | 54K | |
| RTD Event Image.jpg | 2024-07-09 16:40 | 54K | |
| Screen Shot 2018-03-..> | 2024-07-09 16:40 | 54K | |
| Fred Eshelman_0.jpg | 2024-07-09 16:39 | 53K | |
| miningstore.jpg | 2024-07-09 16:40 | 53K | |
| DEL_PRI_RGB.jpg | 2024-07-09 16:39 | 53K | |
| ccc_eventbrite copy.jpg | 2024-07-09 16:39 | 53K | |
| Marshall Gerstein_15..> | 2024-07-09 16:40 | 53K | |
| Winnovation.JPG | 2024-07-09 16:40 | 52K | |
| Phononic_9393_5x7@30..> | 2024-07-09 16:40 | 52K | |
| path_0.png | 2024-07-09 16:40 | 52K | |
| Screen Shot 2017-08-..> | 2024-07-09 16:40 | 52K | |
| Bill Roper 350x350.jpg | 2024-07-09 16:39 | 52K | |
| Max Wallace 350x350.jpg | 2024-07-09 16:40 | 52K | |
| Rich_West 350x350.jpg | 2024-07-09 16:40 | 52K | |
| cleantech connect lo..> | 2024-07-09 16:39 | 52K | |
| large_kristina sandi..> | 2024-07-09 16:40 | 51K | |
| large_kristina sandi..> | 2024-07-09 16:40 | 51K | |
| david-levin (2).jpg | 2024-07-09 16:39 | 51K | |
| DavisPolk.302.RGB_.jpg | 2024-07-09 16:39 | 51K | |
| NETWORK MEET-UP.jpg | 2024-07-09 16:40 | 51K | |
| IdeaFest Logo - even..> | 2024-07-09 16:39 | 51K | |
| Ron Meeusen 352x352.jpg | 2024-07-09 16:40 | 51K | |
| about-ced.jpg | 2024-07-09 16:39 | 51K | |
| Murgitroyd CMYK logo..> | 2024-07-09 16:40 | 51K | |
| Winter_Email_Header.png | 2024-07-09 16:40 | 50K | |
| Burroughs Wellcome.jpg | 2024-07-09 16:39 | 50K | |
| WhyNCWebsiteSlide2.jpg | 2024-07-09 16:40 | 50K | |
| Hutchison.png | 2024-07-09 16:39 | 50K | |
| SBIR Symposium Image..> | 2024-07-09 16:40 | 50K | |
| Paul Headshot 450x45..> | 2024-07-09 16:40 | 49K | |
| seltzer.stacey 350x3..> | 2024-07-09 16:40 | 49K | |
| Ibraheem T. Badejo 3..> | 2024-07-09 16:39 | 49K | |
| Image 5-28-17 at 10...> | 2024-07-09 16:39 | 49K | |
| scott weiner 350x350..> | 2024-07-09 16:40 | 49K | |
| S285-sas100K.jpg | 2024-07-09 16:40 | 49K | |
| WhiteHatAI_Logo_-CED..> | 2024-07-09 16:40 | 48K | |
| WhiteHatAI_Logo_-CED..> | 2024-07-09 16:40 | 48K | |
| Kadir-370x370.jpg | 2024-07-09 16:40 | 48K | |
| Steve_Bloch 350x350.jpg | 2024-07-09 16:40 | 48K | |
| https___cdn.evbuc_.c..> | 2024-07-09 16:39 | 48K | |
| Tracy Harris 375.jpg | 2024-07-09 16:40 | 48K | |
| Growth Company - Dre..> | 2024-07-09 16:39 | 48K | |
| IdeaFest Logo white ..> | 2024-07-09 16:39 | 48K | |
| IdeaFest Logo white ..> | 2024-07-09 16:39 | 48K | |
| HealthSteps-Logo-100..> | 2024-07-09 16:39 | 48K | |
| HealthSteps-Logo-100..> | 2024-07-09 16:39 | 48K | |
| Artificial Intellige..> | 2024-07-09 16:39 | 48K | |
| Growth Company - Tod..> | 2024-07-09 16:39 | 47K | |
| JLL_Logo_Positive-Di..> | 2024-07-09 16:40 | 47K | |
| TVC 17 Growth Compan..> | 2024-07-09 16:40 | 47K | |
| Murali Doraiswamy - ..> | 2024-07-09 16:40 | 47K | |
| Presenting Sponsor B..> | 2024-07-09 16:40 | 47K | |
| CED LSC 2015 Showcas..> | 2024-07-09 16:39 | 46K | |
| 49116.png | 2024-07-09 16:39 | 46K | |
| David Morken 2.jpg | 2024-07-09 16:39 | 46K | |
| Presenting Sponsor B..> | 2024-07-09 16:40 | 46K | |
| Presenting Sponsor B..> | 2024-07-09 16:40 | 46K | |
| michael_nicholson_35..> | 2024-07-09 16:40 | 46K | |
| AFTSST boat photo te..> | 2024-07-09 16:39 | 46K | |
| Blockchain infograph..> | 2024-07-09 16:39 | 46K | |
| AB-Stacked-Logo-smal..> | 2024-07-09 16:39 | 46K | |
| Wingo-head cropped 1..> | 2024-07-09 16:40 | 45K | |
| Holly McConnell Head..> | 2024-07-09 16:39 | 45K | |
| CIBC_BTFYL_Logo_BW_...> | 2024-07-09 16:39 | 45K | |
| Robert_Califf 350x35..> | 2024-07-09 16:40 | 45K | |
| IMG_4781.jpg | 2024-07-09 16:39 | 45K | |
| logo (1).png | 2024-07-09 16:40 | 44K | |
| LOGO.jpg | 2024-07-09 16:40 | 44K | |
| Greenwood 350x350.jpg | 2024-07-09 16:39 | 44K | |
| Oliver Schabenberger..> | 2024-07-09 16:40 | 44K | |
| LES logo .png | 2024-07-09 16:40 | 44K | |
| Gary Glick 350x350.jpg | 2024-07-09 16:39 | 44K | |
| CB Event.JPG | 2024-07-09 16:39 | 44K | |
| Grotech500x300.png | 2024-07-09 16:39 | 44K | |
| muster rdu.jpg | 2024-07-09 16:40 | 44K | |
| Patrick_Conway_2017-..> | 2024-07-09 16:40 | 44K | |
| megboothpowell.jpg | 2024-07-09 16:40 | 43K | |
| Megann Vaughn 350x35..> | 2024-07-09 16:40 | 43K | |
| Kathy Harris 375.jpg | 2024-07-09 16:40 | 43K | |
| Sreekar Mantena 350x..> | 2024-07-09 16:40 | 43K | |
| DemoDay_Eventbrite v..> | 2024-07-09 16:39 | 43K | |
| vibez.jpg | 2024-07-09 16:40 | 43K | |
| 3686 Event.jpg | 2024-07-09 16:39 | 43K | |
| women in bio .png | 2024-07-09 16:40 | 43K | |
| cofounders.png | 2024-07-09 16:39 | 42K | |
| Don Rainey cropped 4..> | 2024-07-09 16:39 | 42K | |
| Chris Heivly 375.jpg | 2024-07-09 16:39 | 42K | |
| Zogo Logo.png | 2024-07-09 16:40 | 42K | |
| dennis-dougherty squ..> | 2024-07-09 16:39 | 42K | |
| Growth Company - Bre..> | 2024-07-09 16:39 | 42K | |
| Estevez headshot 375..> | 2024-07-09 16:39 | 42K | |
| BPW-TRI Logo trans.png | 2024-07-09 16:39 | 41K | |
| nigel-smith-4667762_..> | 2024-07-09 16:40 | 41K | |
| student.jpg | 2024-07-09 16:40 | 41K | |
| Screen Shot 2018-03-..> | 2024-07-09 16:40 | 41K | |
| Paula Brown Stafford..> | 2024-07-09 16:40 | 41K | |
| tommy sowers au.jpg | 2024-07-09 16:40 | 41K | |
| hangar6.png | 2024-07-09 16:39 | 41K | |
| Dory Li - 350x350.jpg | 2024-07-09 16:39 | 40K | |
| CES_CTA_Combo_Logo_1..> | 2024-07-09 16:39 | 40K | |
| kpmg_large.png | 2024-07-09 16:40 | 40K | |
| Ken McBean_0.jpg | 2024-07-09 16:40 | 40K | |
| TPHSD.png | 2024-07-09 16:40 | 40K | |
| Moise.jpg | 2024-07-09 16:40 | 40K | |
| Paul CED.jpg | 2024-07-09 16:40 | 40K | |
| BRCBarfieldLogo.jpeg | 2024-07-09 16:39 | 40K | |
| https___cdn.evbuc_.c..> | 2024-07-09 16:39 | 39K | |
| Cloosiv Logo Black.png | 2024-07-09 16:39 | 39K | |
| Pete Peranzo.JPG | 2024-07-09 16:40 | 39K | |
| New Logo transparent..> | 2024-07-09 16:40 | 39K | |
| Nick Naclerio - 350x..> | 2024-07-09 16:40 | 39K | |
| queen city fintech_0..> | 2024-07-09 16:40 | 39K | |
| queen city fintech.JPG | 2024-07-09 16:40 | 39K | |
| Kelly_Smith.jpg | 2024-07-09 16:40 | 39K | |
| MFS Logo 800.jpg | 2024-07-09 16:40 | 39K | |
| Entrelinks Thumbnail..> | 2024-07-09 16:39 | 39K | |
| Alan Kriz 350x350.jpg | 2024-07-09 16:39 | 39K | |
| Protopia-Logo-Large_..> | 2024-07-09 16:40 | 38K | |
| Protopia-Logo-Large.png | 2024-07-09 16:40 | 38K | |
| Awareness.jpg | 2024-07-09 16:39 | 38K | |
| Growth Company - Dou..> | 2024-07-09 16:39 | 38K | |
| Parion Corporate Log..> | 2024-07-09 16:40 | 38K | |
| 21077497_16616659238..> | 2024-07-09 16:39 | 38K | |
| nirsleep.PNG | 2024-07-09 16:40 | 38K | |
| vaco.png | 2024-07-09 16:40 | 38K | |
| Susan Bihler Headsho..> | 2024-07-09 16:40 | 37K | |
| Eugene Washington 35..> | 2024-07-09 16:39 | 37K | |
| CEDTechConfLogoSquar..> | 2024-07-09 16:39 | 37K | |
| Dennis Gillings Squa..> | 2024-07-09 16:39 | 37K | |
| FIXIONAL_Main.jpg | 2024-07-09 16:39 | 37K | |
| IRHeader1.JPG | 2024-07-09 16:40 | 36K | |
| Garofolo 350x350.jpg | 2024-07-09 16:39 | 36K | |
| ki-logo-website-whit..> | 2024-07-09 16:40 | 36K | |
| Cureat-Full-KOtext-4..> | 2024-07-09 16:39 | 36K | |
| bunker brews process..> | 2024-07-09 16:39 | 36K | |
| SalesJam.jpg | 2024-07-09 16:40 | 36K | |
| Jeff Muir 350x350_0.jpg | 2024-07-09 16:40 | 36K | |
| Screen Shot 2018-05-..> | 2024-07-09 16:40 | 35K | |
| Ravila Gupta 2 .jpg | 2024-07-09 16:40 | 35K | |
| Cisco NEW.png | 2024-07-09 16:39 | 35K | |
| JPM_Logo_667x150.jpg | 2024-07-09 16:40 | 35K | |
| QuintilesIMS-VERT 50..> | 2024-07-09 16:40 | 35K | |
| Kelly Circle 303x304..> | 2024-07-09 16:40 | 34K | |
| Mark Fernandes 350.jpg | 2024-07-09 16:40 | 34K | |
| JuliaCrop2.jpg | 2024-07-09 16:40 | 34K | |
| buck.jpg | 2024-07-09 16:39 | 34K | |
| NCBIOTECH LinkedIn_3..> | 2024-07-09 16:40 | 34K | |
| Screen Shot 2018-05-..> | 2024-07-09 16:40 | 34K | |
| Screen Shot 2018-03-..> | 2024-07-09 16:40 | 34K | |
| productcampRTP-Squar..> | 2024-07-09 16:40 | 34K | |
| Robinson Bradshaw Lo..> | 2024-07-09 16:40 | 34K | |
| Simmons_350x350.jpg | 2024-07-09 16:40 | 34K | |
| Member Meetup Event ..> | 2024-07-09 16:40 | 34K | |
| Member Meetup Event ..> | 2024-07-09 16:40 | 34K | |
| Logo1usethisone.png | 2024-07-09 16:40 | 33K | |
| BP101_BrooksPierce_C..> | 2024-07-09 16:39 | 33K | |
| powered by NC IDEA.png | 2024-07-09 16:40 | 33K | |
| Kim 375x375.jpg | 2024-07-09 16:40 | 33K | |
| nk-patent-law-logo-7..> | 2024-07-09 16:40 | 33K | |
| Steve Hall - 350x350..> | 2024-07-09 16:40 | 33K | |
| jp morgan im.JPG | 2024-07-09 16:40 | 33K | |
| David Baeumler heads..> | 2024-07-09 16:39 | 33K | |
| Adele Oliva - Headsh..> | 2024-07-09 16:39 | 33K | |
| Fred_Hutchison-squar..> | 2024-07-09 16:39 | 33K | |
| Logo.png | 2024-07-09 16:40 | 33K | |
| gardner-partner-e152..> | 2024-07-09 16:39 | 32K | |
| Atcom.png | 2024-07-09 16:39 | 32K | |
| Valassis-Digital-log..> | 2024-07-09 16:40 | 32K | |
| bioaesthetics.jpg | 2024-07-09 16:39 | 32K | |
| DCReceptionBanner.jpg | 2024-07-09 16:39 | 32K | |
| FoodCongraphic.jpg | 2024-07-09 16:39 | 32K | |
| LogoColorTextBelow_2..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_2..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_2..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_2..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_2..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_1..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_1..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_1..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_1..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_1..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_1..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_1..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_1..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_1..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_1..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_9..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_8..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_7..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_6..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_5..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_4..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_3..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_2..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_1..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow_0..> | 2024-07-09 16:40 | 32K | |
| LogoColorTextBelow.jpg | 2024-07-09 16:40 | 32K | |
| CCorangeJ.jpg | 2024-07-09 16:39 | 32K | |
| anil-twitter-headsho..> | 2024-07-09 16:39 | 32K | |
| Pappas-Capital124x10..> | 2024-07-09 16:40 | 32K | |
| nigel-smith-4667762_..> | 2024-07-09 16:40 | 32K | |
| Capture.JPG | 2024-07-09 16:39 | 31K | |
| BWF_logo_red 200x357..> | 2024-07-09 16:39 | 31K | |
| Joe Colopy 363x362.jpg | 2024-07-09 16:40 | 31K | |
| Summer_Icon.png | 2024-07-09 16:40 | 31K | |
| SVB_logo_color.jpg.png | 2024-07-09 16:40 | 31K | |
| Mike Capps 359x350.jpg | 2024-07-09 16:40 | 31K | |
| EternaTear logo.png | 2024-07-09 16:39 | 31K | |
| Wells-Fargo-logo.png | 2024-07-09 16:40 | 31K | |
| DOconnell 350x350.jpg | 2024-07-09 16:39 | 30K | |
| Doug Lebda Tentative..> | 2024-07-09 16:39 | 30K | |
| Andrew ElBardissi 35..> | 2024-07-09 16:39 | 30K | |
| Honeyfi_logo_purple_..> | 2024-07-09 16:39 | 30K | |
| Pepsi_Bottling_Ventu..> | 2024-07-09 16:40 | 30K | |
| IS15 - Logo.png | 2024-07-09 16:40 | 30K | |
| AMA-Logo.png | 2024-07-09 16:39 | 30K | |
| Capitol-Broadcasting..> | 2024-07-09 16:39 | 30K | |
| Matt Melloy.jpg | 2024-07-09 16:40 | 30K | |
| benekiva.png | 2024-07-09 16:39 | 30K | |
| CEDTHUMB.jpg | 2024-07-09 16:39 | 30K | |
| DisruptHR.png | 2024-07-09 16:39 | 30K | |
| F.inmotionnowlogo.png | 2024-07-09 16:39 | 30K | |
| Kim Labow - Headshot..> | 2024-07-09 16:40 | 30K | |
| ExitWorkshop500x500.png | 2024-07-09 16:39 | 29K | |
| ross-medical-educati..> | 2024-07-09 16:40 | 29K | |
| Robin Smith - 352x35..> | 2024-07-09 16:40 | 29K | |
| jobfair.jpg | 2024-07-09 16:40 | 29K | |
| Ben & Jerry's logo.jpg | 2024-07-09 16:39 | 29K | |
| Mark Rostick 375.jpg | 2024-07-09 16:40 | 29K | |
| jorge_ramirez 350x35..> | 2024-07-09 16:40 | 29K | |
| Cempra logo transpar..> | 2024-07-09 16:39 | 29K | |
| logo-dhg.jpg | 2024-07-09 16:40 | 29K | |
| large_JSR-headshot_0..> | 2024-07-09 16:40 | 28K | |
| Hamilton Screenshot ..> | 2024-07-09 16:39 | 28K | |
| Donnelley 200_0.jpg | 2024-07-09 16:39 | 28K | |
| IRE Header.png | 2024-07-09 16:40 | 28K | |
| morrisville-chamber-..> | 2024-07-09 16:40 | 28K | |
| Milestone-Pharmaceut..> | 2024-07-09 16:40 | 28K | |
| MarkMcClellan 350x35..> | 2024-07-09 16:40 | 28K | |
| Michael Cristinziano..> | 2024-07-09 16:40 | 28K | |
| financialdirections_..> | 2024-07-09 16:39 | 28K | |
| large_SDH--headshot_..> | 2024-07-09 16:40 | 28K | |
| Karen Akinsanya - 35..> | 2024-07-09 16:40 | 28K | |
| Meetup Nov 2017 Even..> | 2024-07-09 16:40 | 28K | |
| Nathan Stasko - 350x..> | 2024-07-09 16:40 | 27K | |
| techstars metlife.jpg | 2024-07-09 16:40 | 27K | |
| EY 200.jpg | 2024-07-09 16:39 | 27K | |
| LogoColorTextBelow_2..> | 2024-07-09 16:40 | 27K | |
| Screen Shot 2018-01-..> | 2024-07-09 16:40 | 27K | |
| wilmy.jpg | 2024-07-09 16:40 | 27K | |
| large_MW.jpg | 2024-07-09 16:40 | 27K | |
| MFS.png | 2024-07-09 16:40 | 27K | |
| TierPoint.png | 2024-07-09 16:40 | 27K | |
| Wyrick-Robbins.png | 2024-07-09 16:40 | 27K | |
| Myla Lai-Goldman - 3..> | 2024-07-09 16:40 | 27K | |
| large_JSR--headshot_..> | 2024-07-09 16:40 | 27K | |
| large_JSR--headshot.jpg | 2024-07-09 16:40 | 27K | |
| large_VS--headshot.jpg | 2024-07-09 16:40 | 27K | |
| large_JR--headshot.jpg | 2024-07-09 16:40 | 27K | |
| large_JB--headshot.jpg | 2024-07-09 16:40 | 27K | |
| c&w_1.png | 2024-07-09 16:39 | 27K | |
| Nilesh Kumar - 350x3..> | 2024-07-09 16:40 | 27K | |
| untitled-graphic-21.jpg | 2024-07-09 16:40 | 27K | |
| TLP and RIoT logos.png | 2024-07-09 16:40 | 27K | |
| large_RC--headshot.jpg | 2024-07-09 16:40 | 27K | |
| large_MW_0.jpg | 2024-07-09 16:40 | 27K | |
| Miriam.jpg | 2024-07-09 16:40 | 27K | |
| large_sdh--headshot2..> | 2024-07-09 16:40 | 27K | |
| NC-IDEA_lrg.png | 2024-07-09 16:40 | 26K | |
| Coulter 350x350.jpg | 2024-07-09 16:39 | 26K | |
| dltl-logo.png | 2024-07-09 16:39 | 26K | |
| Tim Lee smaller.jpg | 2024-07-09 16:40 | 26K | |
| large_DP--headshot.jpg | 2024-07-09 16:40 | 26K | |
| Steve Butts - 350x35..> | 2024-07-09 16:40 | 26K | |
| Screen Shot 2017-10-..> | 2024-07-09 16:40 | 26K | |
| haystack.png | 2024-07-09 16:39 | 26K | |
| CED2018LSCHeaderDate..> | 2024-07-09 16:39 | 26K | |
| Bob Young Square.jpg | 2024-07-09 16:39 | 26K | |
| large_CH--headshot.jpg | 2024-07-09 16:40 | 26K | |
| large_JB--headshot_0..> | 2024-07-09 16:40 | 26K | |
| Kayo.JPG | 2024-07-09 16:40 | 25K | |
| CBlogo.jpg | 2024-07-09 16:39 | 25K | |
| NC IDEA Logo 200x92.jpg | 2024-07-09 16:40 | 25K | |
| HPG1.JPG | 2024-07-09 16:39 | 25K | |
| google.png | 2024-07-09 16:39 | 25K | |
| Screen Shot 2017-07-..> | 2024-07-09 16:40 | 25K | |
| wedo-300x230.jpg | 2024-07-09 16:40 | 25K | |
| NCBIO_hir-res_2.png | 2024-07-09 16:40 | 25K | |
| NCBIO_hir-res_1.png | 2024-07-09 16:40 | 25K | |
| NCBIO_hir-res_0.png | 2024-07-09 16:40 | 25K | |
| NCBIO_hir-res.png | 2024-07-09 16:40 | 25K | |
| https---cdn.evbuc_.c..> | 2024-07-09 16:39 | 25K | |
| Charles Merrit - 350..> | 2024-07-09 16:39 | 25K | |
| medium_kristina sand..> | 2024-07-09 16:40 | 25K | |
| ClinipaceWorldwide_o..> | 2024-07-09 16:39 | 24K | |
| LS 2019 Square Logos..> | 2024-07-09 16:40 | 24K | |
| CEDTCRegisterButtons..> | 2024-07-09 16:39 | 24K | |
| Art Pappas - 350x350..> | 2024-07-09 16:39 | 24K | |
| pfizer large logo.jpg | 2024-07-09 16:40 | 24K | |
| webinar.jpg | 2024-07-09 16:40 | 24K | |
| Russ Cobb 350x350.jpg | 2024-07-09 16:40 | 24K | |
| Dallas Romanowski.jpg | 2024-07-09 16:39 | 24K | |
| kwh-coin-final-symbo..> | 2024-07-09 16:40 | 24K | |
| WITI March2017.jpg | 2024-07-09 16:40 | 24K | |
| Victor Hwang Headsho..> | 2024-07-09 16:40 | 24K | |
| Uro1 Inc LOGO_nobckg..> | 2024-07-09 16:40 | 24K | |
| Circadianclock.jpg | 2024-07-09 16:39 | 24K | |
| NACD_Logo_72dpi.jpg | 2024-07-09 16:40 | 24K | |
| RedHat_lrg.png | 2024-07-09 16:40 | 23K | |
| salesjam.png | 2024-07-09 16:40 | 23K | |
| Vade Logo.png | 2024-07-09 16:40 | 23K | |
| the-launch-place-CYM..> | 2024-07-09 16:40 | 23K | |
| startup Summit_0.png | 2024-07-09 16:40 | 23K | |
| MCI_Logo_CMYK.jpg | 2024-07-09 16:40 | 23K | |
| Screen Shot 2018-05-..> | 2024-07-09 16:40 | 23K | |
| Deloitte 200x51_0.jpg | 2024-07-09 16:39 | 23K | |
| Deloitte 200x51.jpg | 2024-07-09 16:39 | 23K | |
| Screen Shot 2018-05-..> | 2024-07-09 16:40 | 23K | |
| Westminster_Logo_pri..> | 2024-07-09 16:40 | 23K | |
| Keith Washo.jpg | 2024-07-09 16:40 | 23K | |
| semda-pitch-round-24..> | 2024-07-09 16:40 | 23K | |
| Fidelity logo.png | 2024-07-09 16:39 | 23K | |
| iContact-logo.jpg | 2024-07-09 16:39 | 23K | |
| CEDLSCRegisterButton..> | 2024-07-09 16:39 | 23K | |
| SBTDC2-IRERT287SBTDC..> | 2024-07-09 16:40 | 22K | |
| Capital Numbers.png | 2024-07-09 16:39 | 22K | |
| AreYouAUnicorn.jpg | 2024-07-09 16:39 | 22K | |
| large_HayTag.final_0..> | 2024-07-09 16:40 | 22K | |
| ncidea.png | 2024-07-09 16:40 | 22K | |
| GrepBeat.JPG | 2024-07-09 16:39 | 22K | |
| Innovate Carolina .png | 2024-07-09 16:39 | 22K | |
| Enpira Logo.jpg | 2024-07-09 16:39 | 22K | |
| DavisMoore-940x450.jpg | 2024-07-09 16:39 | 22K | |
| noro-moseley.png | 2024-07-09 16:40 | 22K | |
| NCBC.jpg | 2024-07-09 16:40 | 22K | |
| ben_0.JPG | 2024-07-09 16:39 | 21K | |
| lifeflow.JPG | 2024-07-09 16:40 | 21K | |
| Meeting Advantage 20..> | 2024-07-09 16:40 | 21K | |
| silicon valley heads..> | 2024-07-09 16:40 | 21K | |
| Max Wallace 350x350 ..> | 2024-07-09 16:40 | 21K | |
| LTLS_Logo_500x500_0.png | 2024-07-09 16:40 | 21K | |
| LTLS_Logo_500x500.png | 2024-07-09 16:40 | 21K | |
| NEXS_blk(1).png | 2024-07-09 16:40 | 21K | |
| cooley-logo-red-pms1..> | 2024-07-09 16:39 | 21K | |
| CED Logo Blue.png | 2024-07-09 16:39 | 21K | |
| rbc-wm-logo-en.png | 2024-07-09 16:40 | 20K | |
| Pcamp.jpg | 2024-07-09 16:40 | 20K | |
| CED LSC.jpg | 2024-07-09 16:39 | 20K | |
| Treg-Therapeutics-Lo..> | 2024-07-09 16:40 | 20K | |
| Life-Sciences-Logo2.jpg | 2024-07-09 16:40 | 20K | |
| allstacks.png | 2024-07-09 16:39 | 20K | |
| WITS-300.jpg | 2024-07-09 16:40 | 20K | |
| ChannelAdvisor.png | 2024-07-09 16:39 | 20K | |
| MainLogo_300x300.png | 2024-07-09 16:40 | 20K | |
| StartupGrind.png | 2024-07-09 16:40 | 20K | |
| CEDTCRegisterButtons..> | 2024-07-09 16:39 | 20K | |
| Padma-234x300.jpg | 2024-07-09 16:40 | 19K | |
| Screen Shot 2018-03-..> | 2024-07-09 16:40 | 19K | |
| Wake Forest Innovati..> | 2024-07-09 16:40 | 19K | |
| IBM logo .png | 2024-07-09 16:39 | 19K | |
| Sheila Mikhail 350x3..> | 2024-07-09 16:40 | 19K | |
| large_MobiCompete_Fu..> | 2024-07-09 16:40 | 19K | |
| BABCNC.jpg | 2024-07-09 16:39 | 19K | |
| SeBio-2017-Logo-web-..> | 2024-07-09 16:40 | 19K | |
| Bioventus.png | 2024-07-09 16:39 | 19K | |
| Hutchison PLLC - PNG..> | 2024-07-09 16:39 | 19K | |
| Jan2017.jpg | 2024-07-09 16:40 | 19K | |
| Glaxo-Smith-Kline_tr..> | 2024-07-09 16:39 | 18K | |
| Celldom_Logo_375x300..> | 2024-07-09 16:39 | 18K | |
| rely-final-large-tra..> | 2024-07-09 16:40 | 18K | |
| uncLogo.png | 2024-07-09 16:40 | 18K | |
| Groundworks_1.jpg | 2024-07-09 16:39 | 18K | |
| Groundworks_0.jpg | 2024-07-09 16:39 | 18K | |
| Groundworks.jpg | 2024-07-09 16:39 | 18K | |
| JPM_Logo_200x44.jpg | 2024-07-09 16:40 | 18K | |
| IRE_Web_banner2_0.png | 2024-07-09 16:40 | 18K | |
| IRE_Web_banner2.png | 2024-07-09 16:40 | 18K | |
| startup Summit.png | 2024-07-09 16:40 | 18K | |
| ProductCampRTP Logo ..> | 2024-07-09 16:40 | 18K | |
| ProductCampRTP Logo ..> | 2024-07-09 16:40 | 18K | |
| BW_hor_logo_flat.png | 2024-07-09 16:39 | 17K | |
| IELogo_75.jpg | 2024-07-09 16:39 | 17K | |
| jwthlogo_0.jpg | 2024-07-09 16:40 | 17K | |
| COIN_0.jpg | 2024-07-09 16:39 | 17K | |
| COIN.jpg | 2024-07-09 16:39 | 17K | |
| large_blue_600px.png | 2024-07-09 16:40 | 17K | |
| I'mBlackinTech.jpg | 2024-07-09 16:39 | 17K | |
| cherry1.jpg | 2024-07-09 16:39 | 17K | |
| ORIED_logo_red_h-01.jpg | 2024-07-09 16:40 | 17K | |
| i-8 logo copy.jpg | 2024-07-09 16:39 | 17K | |
| CED2018LSCHeaderDate..> | 2024-07-09 16:39 | 17K | |
| DCRI_logo1_0.png | 2024-07-09 16:39 | 17K | |
| exitevent.jpg | 2024-07-09 16:39 | 17K | |
| ExitEvent_5.jpg | 2024-07-09 16:39 | 17K | |
| ExitEvent_4.jpg | 2024-07-09 16:39 | 17K | |
| ExitEvent_3.jpg | 2024-07-09 16:39 | 17K | |
| ExitEvent_2.jpg | 2024-07-09 16:39 | 17K | |
| ExitEvent_1.jpg | 2024-07-09 16:39 | 17K | |
| ExitEvent_0.jpg | 2024-07-09 16:39 | 17K | |
| Hatteras-Venture-Par..> | 2024-07-09 16:39 | 17K | |
| DCRI_logo_1.png | 2024-07-09 16:39 | 16K | |
| silicon valley heads..> | 2024-07-09 16:40 | 16K | |
| a2504a03386b5157773a..> | 2024-07-09 16:39 | 16K | |
| kilpatrick-townsend-..> | 2024-07-09 16:40 | 16K | |
| InnovationDelivers35..> | 2024-07-09 16:40 | 16K | |
| Kenan_Institute_hire..> | 2024-07-09 16:40 | 16K | |
| Screen Shot 2018-03-..> | 2024-07-09 16:40 | 16K | |
| Screen Shot 2018-04-..> | 2024-07-09 16:40 | 16K | |
| HamiltonPoint_web.jpg | 2024-07-09 16:39 | 16K | |
| Bioventus_med 200x40..> | 2024-07-09 16:39 | 16K | |
| A-NCBigShot-sticker_..> | 2024-07-09 16:39 | 16K | |
| Bunker-Labs-RDU-Logo..> | 2024-07-09 16:39 | 16K | |
| Glaxo Smith Kline_sm..> | 2024-07-09 16:39 | 15K | |
| Betr_Logo_withtaglin..> | 2024-07-09 16:39 | 15K | |
| Betr_Logo_withtaglin..> | 2024-07-09 16:39 | 15K | |
| DCRI_logo_0.png | 2024-07-09 16:39 | 15K | |
| DCRI_logo.png | 2024-07-09 16:39 | 15K | |
| ZigZibit200.jpg | 2024-07-09 16:40 | 15K | |
| ZigZibit.jpg | 2024-07-09 16:40 | 15K | |
| Internet-Summit.jpg | 2024-07-09 16:40 | 15K | |
| logo_2_0_0.png | 2024-07-09 16:40 | 15K | |
| logo_2_0.png | 2024-07-09 16:40 | 15K | |
| BABCNC small_1.png | 2024-07-09 16:39 | 15K | |
| BABCNC small_0.png | 2024-07-09 16:39 | 15K | |
| BABCNC small.png | 2024-07-09 16:39 | 15K | |
| CrowdfundNC_logo_cro..> | 2024-07-09 16:39 | 15K | |
| LOGO_1.jpg | 2024-07-09 16:40 | 15K | |
| LOGO_0.jpg | 2024-07-09 16:40 | 15K | |
| large_logo_gray_no-t..> | 2024-07-09 16:40 | 15K | |
| SciQuest 2016.png | 2024-07-09 16:40 | 14K | |
| medium_EngineOfInnov..> | 2024-07-09 16:40 | 14K | |
| internet summit.JPG | 2024-07-09 16:40 | 14K | |
| produce box.JPG | 2024-07-09 16:40 | 14K | |
| medium_JSR-headshot.jpg | 2024-07-09 16:40 | 14K | |
| medium_SDH--headshot..> | 2024-07-09 16:40 | 14K | |
| Scale-Finance_lrg.png | 2024-07-09 16:40 | 14K | |
| medium_NCBIO_hir-res..> | 2024-07-09 16:40 | 14K | |
| logo (2).png | 2024-07-09 16:40 | 14K | |
| large_fluree_db@4x (..> | 2024-07-09 16:40 | 14K | |
| large_bruvue_logo-12..> | 2024-07-09 16:40 | 14K | |
| Jay.JPG | 2024-07-09 16:40 | 14K | |
| medium_LB--headshot.jpg | 2024-07-09 16:40 | 14K | |
| unnamed.jpg | 2024-07-09 16:40 | 14K | |
| Arrevus_20logo_20PNG..> | 2024-07-09 16:39 | 14K | |
| icon_beehyve_master.png | 2024-07-09 16:39 | 14K | |
| Wyrick-Robbins-Stand..> | 2024-07-09 16:40 | 14K | |
| LogoColor.png | 2024-07-09 16:40 | 13K | |
| FireShot Capture 52 ..> | 2024-07-09 16:39 | 13K | |
| https___cdn.evbuc_.c..> | 2024-07-09 16:39 | 13K | |
| RTI_trans.png | 2024-07-09 16:40 | 13K | |
| Triangle_Logo_Landsc..> | 2024-07-09 16:40 | 13K | |
| Triangle_Logo_Landsc..> | 2024-07-09 16:40 | 13K | |
| Triangle_Logo_Landsc..> | 2024-07-09 16:40 | 13K | |
| logo (3).png | 2024-07-09 16:40 | 13K | |
| ced-callout2.jpg | 2024-07-09 16:39 | 13K | |
| RTCC-logo-tag-jpeg.jpg | 2024-07-09 16:40 | 13K | |
| RHV_logo_color_blue.png | 2024-07-09 16:40 | 13K | |
| Screen Shot 2017-12-..> | 2024-07-09 16:40 | 13K | |
| Bioventus_med 155.png | 2024-07-09 16:39 | 13K | |
| Life-Sciences-Logo22..> | 2024-07-09 16:40 | 13K | |
| large_Patheon Logo.png | 2024-07-09 16:40 | 13K | |
| Wingo.JPG | 2024-07-09 16:40 | 13K | |
| V4 130x100_0.jpg | 2024-07-09 16:40 | 13K | |
| V4 130x100.jpg | 2024-07-09 16:40 | 13K | |
| LabCorp.jpg | 2024-07-09 16:40 | 13K | |
| WRAL 200.png | 2024-07-09 16:40 | 13K | |
| LC_StartupWeekend_BG..> | 2024-07-09 16:40 | 13K | |
| BCBSNC 213x100.jpg | 2024-07-09 16:39 | 12K | |
| rtcclogo.png | 2024-07-09 16:40 | 12K | |
| Raleigh Cleantech Cl..> | 2024-07-09 16:40 | 12K | |
| Samanage.jpg | 2024-07-09 16:40 | 12K | |
| 1.jpg | 2024-07-09 16:39 | 12K | |
| Michael Best.JPG | 2024-07-09 16:40 | 12K | |
| Staff pics.jpg | 2024-07-09 16:40 | 12K | |
| Railinc.png | 2024-07-09 16:40 | 12K | |
| TransdataLogoTagTran..> | 2024-07-09 16:40 | 12K | |
| Triangle Tecch BigTo..> | 2024-07-09 16:40 | 12K | |
| GES NCSU.jpg | 2024-07-09 16:39 | 12K | |
| rtpaitp.jpg | 2024-07-09 16:40 | 12K | |
| SBTDC.jpg | 2024-07-09 16:40 | 12K | |
| Staff pics2.jpg | 2024-07-09 16:40 | 12K | |
| phononiclogo-rgb_600..> | 2024-07-09 16:40 | 12K | |
| Staff pics3.jpg | 2024-07-09 16:40 | 12K | |
| harbert_0.jpg | 2024-07-09 16:39 | 12K | |
| greycroft500x300.png | 2024-07-09 16:39 | 12K | |
| RIoT_ED.png | 2024-07-09 16:40 | 12K | |
| full-color-RGB-300x8..> | 2024-07-09 16:39 | 11K | |
| full-color-RGB-300x8..> | 2024-07-09 16:39 | 11K | |
| hearful logo.jpg | 2024-07-09 16:39 | 11K | |
| tvc2 266.png | 2024-07-09 16:40 | 11K | |
| Hand shake.jpg | 2024-07-09 16:39 | 11K | |
| NCBiotech_logo_stack..> | 2024-07-09 16:40 | 11K | |
| sweeps.JPG | 2024-07-09 16:40 | 11K | |
| Citrix-Logo-EPS-vect..> | 2024-07-09 16:39 | 11K | |
| JandJ.png | 2024-07-09 16:40 | 11K | |
| Hutchison_2_color.png | 2024-07-09 16:39 | 11K | |
| LSC--Square-Banner (..> | 2024-07-09 16:40 | 11K | |
| merz.png | 2024-07-09 16:40 | 11K | |
| symmune.PNG | 2024-07-09 16:40 | 11K | |
| Register.jpg | 2024-07-09 16:40 | 11K | |
| 0 (1).png | 2024-07-09 16:39 | 10K | |
| BioLabs_NC_Logo_CMYK..> | 2024-07-09 16:39 | 10K | |
| myxx logo.png | 2024-07-09 16:40 | 10K | |
| gsk.jpg | 2024-07-09 16:39 | 10K | |
| NCTA.jpg | 2024-07-09 16:40 | 10K | |
| 0.png | 2024-07-09 16:39 | 10K | |
| EDM .png | 2024-07-09 16:39 | 10K | |
| Grant-Thornton_Panto..> | 2024-07-09 16:39 | 10K | |
| RIoT-Square_1.png | 2024-07-09 16:40 | 10K | |
| RIoT-Square_0.png | 2024-07-09 16:40 | 10K | |
| RIoT-Square.png | 2024-07-09 16:40 | 10K | |
| Cherry-Bekaert-LLP.png | 2024-07-09 16:39 | 10K | |
| CEDTechConfLogoSquar..> | 2024-07-09 16:39 | 10K | |
| medium_Balentine Log..> | 2024-07-09 16:40 | 10K | |
| RIoT_Logo-2016.png | 2024-07-09 16:40 | 10K | |
| CED logo.png | 2024-07-09 16:39 | 10K | |
| Duke Energy.jpg | 2024-07-09 16:39 | 9.9K | |
| Bridge Bank small.jpg | 2024-07-09 16:39 | 9.9K | |
| medium_ehr20-new-log..> | 2024-07-09 16:40 | 9.8K | |
| nest-logo-dark.png | 2024-07-09 16:40 | 9.8K | |
| ncbio_logo_tagline.png | 2024-07-09 16:40 | 9.8K | |
| roobrik logo.png | 2024-07-09 16:40 | 9.8K | |
| DLTL-logomark-400x40..> | 2024-07-09 16:39 | 9.8K | |
| Bull City Venture_0.jpg | 2024-07-09 16:39 | 9.7K | |
| swir-logo_0.png | 2024-07-09 16:40 | 9.6K | |
| swir-logo.png | 2024-07-09 16:40 | 9.6K | |
| aperio.png | 2024-07-09 16:39 | 9.6K | |
| raleigh digital marc..> | 2024-07-09 16:40 | 9.6K | |
| Novus Logo.jpg | 2024-07-09 16:40 | 9.6K | |
| harper-savii.jpg | 2024-07-09 16:39 | 9.6K | |
| UKGreatDep200x51.jpg | 2024-07-09 16:40 | 9.5K | |
| Alexandria-Real-Esta..> | 2024-07-09 16:39 | 9.3K | |
| Avalara.png | 2024-07-09 16:39 | 9.2K | |
| ehr20-new-logo_0.png | 2024-07-09 16:39 | 9.2K | |
| ehr20-new-logo.png | 2024-07-09 16:39 | 9.2K | |
| HQRaleigh.png | 2024-07-09 16:39 | 9.2K | |
| small_New Date Banne..> | 2024-07-09 16:40 | 9.0K | |
| Alfred Williams 200.png | 2024-07-09 16:39 | 9.0K | |
| Ken Romley - Zift So..> | 2024-07-09 16:40 | 8.7K | |
| small_HayTag.final.jpg | 2024-07-09 16:40 | 8.6K | |
| PwC.png | 2024-07-09 16:40 | 8.6K | |
| New IronNet Logo.png | 2024-07-09 16:40 | 8.4K | |
| smith anderson small..> | 2024-07-09 16:40 | 8.3K | |
| logo244.png | 2024-07-09 16:40 | 8.3K | |
| Syneos Logo - small.jpg | 2024-07-09 16:40 | 8.2K | |
| Vaco.jpg | 2024-07-09 16:40 | 8.2K | |
| Apply Button.jpg | 2024-07-09 16:39 | 8.1K | |
| ins.png | 2024-07-09 16:40 | 8.1K | |
| McGriff.jpg | 2024-07-09 16:40 | 7.9K | |
| Deloitte 155.png | 2024-07-09 16:39 | 7.8K | |
| SEBIO.png | 2024-07-09 16:40 | 7.7K | |
| meeting advantage.jpg | 2024-07-09 16:40 | 7.7K | |
| Ogletree Deakins.jpg | 2024-07-09 16:40 | 7.6K | |
| uspire.PNG | 2024-07-09 16:40 | 7.6K | |
| Tierpoint logo.png | 2024-07-09 16:40 | 7.5K | |
| HUB.png | 2024-07-09 16:39 | 7.5K | |
| CIO.jpg | 2024-07-09 16:39 | 7.4K | |
| Syneos Health logo.png | 2024-07-09 16:40 | 7.3K | |
| Brinks Gilson.png | 2024-07-09 16:39 | 7.2K | |
| LENOVO.png | 2024-07-09 16:40 | 7.2K | |
| Baebies_Reg_Logo_NT_..> | 2024-07-09 16:39 | 7.2K | |
| Full Scale Solutions..> | 2024-07-09 16:39 | 7.2K | |
| PNC_lrg 200.png | 2024-07-09 16:40 | 7.0K | |
| rankin.png | 2024-07-09 16:40 | 7.0K | |
| Intersouth-Partners_..> | 2024-07-09 16:40 | 6.9K | |
| Mobile Reach full_co..> | 2024-07-09 16:40 | 6.9K | |
| unitherlogo 250x60.jpg | 2024-07-09 16:40 | 6.8K | |
| Square 1 - 200.jpg | 2024-07-09 16:40 | 6.8K | |
| Storydriven Logo_1.jpeg | 2024-07-09 16:40 | 6.7K | |
| Veracity Logic logo.png | 2024-07-09 16:40 | 6.7K | |
| BeeWell Logo.jpg | 2024-07-09 16:39 | 6.6K | |
| Compliance.jpg | 2024-07-09 16:39 | 6.6K | |
| PMD LL_color_180px L..> | 2024-07-09 16:40 | 6.6K | |
| granttho rnton.jpg | 2024-07-09 16:39 | 6.6K | |
| Young Entreprenuers.jpg | 2024-07-09 16:40 | 6.6K | |
| NCBiotech_logo_stack..> | 2024-07-09 16:40 | 6.4K | |
| NCBiotech_logo_stack..> | 2024-07-09 16:40 | 6.4K | |
| EHR 2.0 logo.png | 2024-07-09 16:39 | 6.4K | |
| Hutchison Law Group_..> | 2024-07-09 16:39 | 6.3K | |
| NCBiotech_logo_stack..> | 2024-07-09 16:40 | 6.3K | |
| medium_Patheon Logo_..> | 2024-07-09 16:40 | 6.2K | |
| Cisco.png | 2024-07-09 16:39 | 6.2K | |
| Eldec Logo.jpg | 2024-07-09 16:39 | 6.2K | |
| PNC_lrg 155.png | 2024-07-09 16:40 | 6.2K | |
| AARP 200x57_0.jpg | 2024-07-09 16:39 | 6.1K | |
| AARP 200x57.jpg | 2024-07-09 16:39 | 6.1K | |
| DCRI_logo.jpg | 2024-07-09 16:39 | 6.1K | |
| bigtop-logo-lg.png | 2024-07-09 16:39 | 6.1K | |
| ARE_orig 200.png | 2024-07-09 16:39 | 6.0K | |
| Wake Forest Innovati..> | 2024-07-09 16:40 | 6.0K | |
| bradley final.png | 2024-07-09 16:39 | 5.9K | |
| Bandwidth 200.jpg | 2024-07-09 16:39 | 5.9K | |
| citrix-logo.png | 2024-07-09 16:39 | 5.9K | |
| River_Cities_vestor_..> | 2024-07-09 16:40 | 5.9K | |
| bunker labs.png | 2024-07-09 16:39 | 5.8K | |
| Merck 200x63.jpg | 2024-07-09 16:40 | 5.8K | |
| WeWork Logo.png | 2024-07-09 16:40 | 5.7K | |
| wilson.png | 2024-07-09 16:40 | 5.6K | |
| DukeCS.png | 2024-07-09 16:39 | 5.5K | |
| aw-logo1.jpg | 2024-07-09 16:39 | 5.5K | |
| WR-logo-102x125.jpg | 2024-07-09 16:40 | 5.2K | |
| BioLabs_NC_Logo_CMYK..> | 2024-07-09 16:39 | 5.0K | |
| https___i.forbesimg...> | 2024-07-09 16:39 | 4.9K | |
| LSC--Banner-for-Regi..> | 2024-07-09 16:40 | 4.8K | |
| fhi360.png | 2024-07-09 16:39 | 4.6K | |
| ExitEvent1_2.png | 2024-07-09 16:39 | 4.6K | |
| ExitEvent1_1.png | 2024-07-09 16:39 | 4.6K | |
| ExitEvent1_0.png | 2024-07-09 16:39 | 4.6K | |
| ExitEvent1.png | 2024-07-09 16:39 | 4.6K | |
| partners-logo1.jpg | 2024-07-09 16:40 | 4.5K | |
| soar.png | 2024-07-09 16:40 | 4.4K | |
| urbanoffsetslogo.png | 2024-07-09 16:40 | 4.3K | |
| donnelleyfinancial.jpeg | 2024-07-09 16:39 | 4.3K | |
| snapsolv logo.png | 2024-07-09 16:40 | 4.2K | |
| dfinsmall_0.jpg | 2024-07-09 16:39 | 4.2K | |
| dfinsmall.jpg | 2024-07-09 16:39 | 4.2K | |
| small_Patheon Logo_0..> | 2024-07-09 16:40 | 4.2K | |
| ey Logo.png | 2024-07-09 16:39 | 4.1K | |
| alexandria.png | 2024-07-09 16:39 | 4.0K | |
| Smith Anderson logo ..> | 2024-07-09 16:40 | 4.0K | |
| 15839.gif | 2024-07-09 16:39 | 3.9K | |
| pendo.png | 2024-07-09 16:40 | 3.8K | |
| WR-logo-81x100_0.jpg | 2024-07-09 16:40 | 3.7K | |
| vanmile logo_0.png | 2024-07-09 16:40 | 3.7K | |
| Cooley.png | 2024-07-09 16:39 | 3.7K | |
| CHERRYBIG.png | 2024-07-09 16:39 | 3.7K | |
| red hat_6.png | 2024-07-09 16:40 | 3.4K | |
| red hat_5.png | 2024-07-09 16:40 | 3.4K | |
| red hat_4.png | 2024-07-09 16:40 | 3.4K | |
| red hat_3.png | 2024-07-09 16:40 | 3.4K | |
| red hat_2.png | 2024-07-09 16:40 | 3.4K | |
| red hat_1.png | 2024-07-09 16:40 | 3.4K | |
| red hat_0.png | 2024-07-09 16:40 | 3.4K | |
| red hat.png | 2024-07-09 16:40 | 3.4K | |
| RegisterButton180x10..> | 2024-07-09 16:40 | 3.4K | |
| clarkston.png | 2024-07-09 16:39 | 3.4K | |
| Thrift_0.PNG | 2024-07-09 16:40 | 3.3K | |
| Thrift.PNG | 2024-07-09 16:40 | 3.3K | |
| ZIG Logo_0.png | 2024-07-09 16:40 | 3.2K | |
| ZIG Logo.png | 2024-07-09 16:40 | 3.2K | |
| Fintech Generations ..> | 2024-07-09 16:39 | 3.1K | |
| somo.png | 2024-07-09 16:40 | 3.0K | |
| arrows.png | 2024-07-09 16:39 | 2.9K | |
| wellnecity logo.jpg | 2024-07-09 16:40 | 2.5K | |
| mosaic .png | 2024-07-09 16:40 | 2.4K | |
| rtp cfo logo_8.gif | 2024-07-09 16:40 | 2.4K | |
| rtp cfo logo_7.gif | 2024-07-09 16:40 | 2.4K | |
| rtp cfo logo_6.gif | 2024-07-09 16:40 | 2.4K | |
| rtp cfo logo_5.gif | 2024-07-09 16:40 | 2.4K | |
| rtp cfo logo_4.gif | 2024-07-09 16:40 | 2.4K | |
| rtp cfo logo_3.gif | 2024-07-09 16:40 | 2.4K | |
| rtp cfo logo_2.gif | 2024-07-09 16:40 | 2.4K | |
| rtp cfo logo_1.gif | 2024-07-09 16:40 | 2.4K | |
| rtp cfo logo_0.gif | 2024-07-09 16:40 | 2.4K | |
| rtp cfo logo.gif | 2024-07-09 16:40 | 2.4K | |
| vanmile logo.png | 2024-07-09 16:40 | 2.4K | |
| slide-icon3_1.png | 2024-07-09 16:40 | 2.4K | |
| slide-icon3.png | 2024-07-09 16:40 | 2.4K | |
| trinet.png | 2024-07-09 16:40 | 2.3K | |
| slide-icon1_0_1.png | 2024-07-09 16:40 | 2.1K | |
| slide-icon1_0.png | 2024-07-09 16:40 | 2.1K | |
| slide-icon1.png | 2024-07-09 16:40 | 2.1K | |
| logo-eventbrite.png | 2024-07-09 16:40 | 1.7K | |
| LinkedInLogo30.jpg | 2024-07-09 16:40 | 1.6K | |
| Wyrick Robbins_sm_gr..> | 2024-07-09 16:40 | 1.6K | |
| TwitterLogo30.jpg | 2024-07-09 16:40 | 1.5K | |
| DB global_0.png | 2024-07-09 16:39 | 1.4K | |
| DB global.png | 2024-07-09 16:39 | 1.4K | |
| brooks pierce 200px.png | 2024-07-09 16:39 | 1.4K | |
| slide-icon2.png | 2024-07-09 16:40 | 1.4K | |
| FacebookLogo27.jpg | 2024-07-09 16:39 | 1.3K | |
| inmotionnowlogo.png | 2024-07-09 16:39 | 1.1K | |
| next money.png | 2024-07-09 16:40 | 913 | |
